CAS 24577-90-0: Rubrofusarin gentiobioside
Description:Rubrofusarin gentiobioside is a chemical compound classified as a flavonoid glycoside, which is derived from the natural product rubrofusarin. It is characterized by its glycosidic structure, where a gentiobiose sugar moiety is attached to the flavonoid backbone. This compound is known for its potential biological activities, including antioxidant properties, which may contribute to its role in plant defense mechanisms. Rubrofusarin gentiobioside is typically found in certain plant species and may exhibit various pharmacological effects, although specific studies on its efficacy and mechanisms of action are limited. The compound's solubility, stability, and reactivity can vary depending on environmental conditions and the presence of other substances. As with many flavonoids, it may also have implications in food science and nutrition, particularly in relation to its health benefits. Further research is necessary to fully elucidate its properties and potential applications in medicine and industry.
Formula:C27H32O15
InChI:InChI=1S/C27H32O15/c1-9-3-12(29)18-13(39-9)5-10-4-11(37-2)6-14(17(10)21(18)32)40-27-25(36)23(34)20(31)16(42-27)8-38-26-24(35)22(33)19(30)15(7-28)41-26/h3-6,15-16,19-20,22-28,30-36H,7-8H2,1-2H3/t15-,16-,19-,20-,22+,23+,24-,25-,26-,27-/m1/s1
InChI key:InChIKey=JIBJMBHKGBDCPN-IJTBWITGSA-N
SMILES:O=C1C=C(OC2=CC=3C=C(OC)C=C(OC4OC(COC5OC(CO)C(O)C(O)C5O)C(O)C(O)C4O)C3C(O)=C12)C
- Synonyms:
- Rubrofusarin gentiobioside
- 4H-Naphtho[2,3-b]pyran-4-one, 6-[(6-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-
- 6-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one
- Glucopyranoside, 5-hydroxy-8-methoxy-2-methyl-4-oxo-4H-naphtho[2,3-b]pyran-6-yl 6-O-β-D-glucopyranosyl-, β-D-
- Rubrofusarin 6-O-β-D-gentiobioside
