CAS 24577-90-0
:Rubrofusarin gentiobioside
Description:
Rubrofusarin gentiobioside is a chemical compound classified as a flavonoid glycoside, which is derived from the natural product rubrofusarin. It is characterized by its glycosidic structure, where a gentiobiose sugar moiety is attached to the flavonoid backbone. This compound is known for its potential biological activities, including antioxidant properties, which may contribute to its role in plant defense mechanisms. Rubrofusarin gentiobioside is typically found in certain plant species and may exhibit various pharmacological effects, although specific studies on its efficacy and mechanisms of action are limited. The compound's solubility, stability, and reactivity can vary depending on environmental conditions and the presence of other substances. As with many flavonoids, it may also have implications in food science and nutrition, particularly in relation to its health benefits. Further research is necessary to fully elucidate its properties and potential applications in medicine and industry.
Formula:C27H32O15
InChI:InChI=1S/C27H32O15/c1-9-3-12(29)18-13(39-9)5-10-4-11(37-2)6-14(17(10)21(18)32)40-27-25(36)23(34)20(31)16(42-27)8-38-26-24(35)22(33)19(30)15(7-28)41-26/h3-6,15-16,19-20,22-28,30-36H,7-8H2,1-2H3/t15-,16-,19-,20-,22+,23+,24-,25-,26-,27-/m1/s1
InChI key:InChIKey=JIBJMBHKGBDCPN-IJTBWITGSA-N
SMILES:O(C=1C2=C(C=C3C(=C2O)C(=O)C=C(C)O3)C=C(OC)C1)[C@@H]4O[C@H](CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O
Synonyms:- Rubrofusarin gentiobioside
- 4H-Naphtho[2,3-b]pyran-4-one, 6-[(6-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-
- 6-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one
- Glucopyranoside, 5-hydroxy-8-methoxy-2-methyl-4-oxo-4H-naphtho[2,3-b]pyran-6-yl 6-O-β-D-glucopyranosyl-, β-D-
- Rubrofusarin 6-O-β-D-gentiobioside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Rubrofusarin gentiobioside
CAS:Rubrofusarin gentiobioside (Rubrofusarin-6-O-beta-D-gentiobioside) decreases the expression of TGF-beta1 and fibronectin and NF-kappaB DNA binding activity.Formula:C27H32O15Purity:99.91% - 99.93%Color and Shape:SolidMolecular weight:596.53Rubrofusarin gentiobioside
CAS:Rubrofusarin gentiobioside is a naturally occurring bioactive compound, which is a phenolic glucoside derived from various species of fungi, particularly those in the genus Fusarium. This compound exhibits its mode of action through antioxidant activity, potentially interfering with oxidative stress pathways and inhibiting free radical formation. Its structure allows it to scavenge reactive oxygen species effectively, which may contribute to its protective effects in biological systems.Formula:C27H32O15Purity:Min. 95%Molecular weight:596.5 g/mol





