CAS 2458-08-4
:12-Ketochenodeoxycholic acid
Description:
12-Ketochenodeoxycholic acid, with the CAS number 2458-08-4, is a bile acid derivative that plays a significant role in lipid metabolism and digestion. It is characterized by its keto group at the 12-position of the steroid nucleus, which distinguishes it from its parent compound, chenodeoxycholic acid. This compound is typically found in the bile of various species and is involved in the emulsification and absorption of dietary fats. Its structure includes a hydrophobic steroid backbone with hydroxyl groups that contribute to its amphipathic nature, allowing it to interact with both lipids and water. 12-Ketochenodeoxycholic acid has been studied for its potential therapeutic applications, particularly in the context of metabolic disorders and liver function. Additionally, it may influence cholesterol metabolism and has been investigated for its role in various biological processes, including signaling pathways. Overall, this compound is an important player in the complex biochemistry of bile acids and their physiological functions.
Formula:C24H38O5
InChI:InChI=1S/C24H38O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-19,22,25-26H,4-12H2,1-3H3,(H,28,29)/t13-,14+,15-,16-,17+,18+,19-,22+,23+,24-/m1/s1
InChI key:InChIKey=MIHNUBCEFJLAGN-DMMBONCOSA-N
SMILES:O[C@H]1[C@]2([C@]3([C@@](C)([C@@]([C@@H](CCC(O)=O)C)(CC3)[H])C(=O)C[C@@]2([C@]4(C)[C@](C1)(C[C@H](O)CC4)[H])[H])[H])[H]
Synonyms:- (3Alpha,5Beta,7Alpha)-3,7-Dihydroxy-12-Oxocholan-24-Oic Acid
- (3α,5β,7α)-3,7-Dihydroxy-12-oxocholan-24-oic acid
- 12-Keto-3α,7α-dihydroxy-5β-cholanic acid
- 12-Ketochenodeoxycholic acid
- 12-Ketocholic acid
- 12-Oxo-3α,7α-dihydroxy-5β-cholan-24-oic acid
- 12-Oxochenodeoxycholic acid
- 12-Oxocholic acid
- 12-keto-Chenodeoxycholic acid
- 3,7-Dihydroxy-12-oxocholanoic acid
- 3alpha,7alpha-Dihydroxy-12-oxo-5beta-cholan-24-oic acid
- 3α,7α-Dihydroxy-12-keto-5β-cholanic acid
- 3α,7α-Dihydroxy-12-ketocholanic acid
- 3α,7α-Dihydroxy-12-ketocholic acid
- 3α,7α-Dihydroxy-12-oxo-5β-cholanic acid
- 3α,7α-Dihydroxy-12-oxo-5β-cholanoic acid
- 3α,7α-Dihydroxy-12-oxocholic acid
- 5β-Cholan-24-oic acid, 3α,7α-dihydroxy-12-oxo-
- 5β-Cholanic acid, 3α,7α-dihydroxy-12-oxo-
- 5β-Cholanic acid-3α,7α-diol-12-one
- Cholan-24-oic acid, 3,7-dihydroxy-12-oxo-, (3 alpha,5 beta,7 alpha)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Chenodeoxycholic Acid EP Impurity H (12-Oxochenodeoxycholic Acid)
CAS:Formula:C24H38O5Molecular weight:406.5612-keto-Chenodeoxycholic Acid
CAS:Formula:C24H38O5Purity:>99%Color and Shape:SolidMolecular weight:406.56(3a,5b,7a)-3,7-Dihydroxy-12-oxo-cholan-24-oic acid
CAS:Controlled Product(3a,5b,7a)-3,7-Dihydroxy-12-oxo-cholan-24-oic acid is a bile acid derivative, which is a type of naturally occurring steroid acid found predominantly in the bile of mammals. Bile acids play a crucial role in the digestion and absorption of lipids in the small intestine. This compound is synthesized from cholesterol in the liver, where it functions in the emulsification of dietary fats.
Formula:C24H38O5Purity:Min. 95%Molecular weight:406.6 g/mol



