CAS 24587-32-4: gly-hydroxy-pro
Description:The chemical substance known as gly-hydroxy-pro, with the CAS number 24587-32-4, is a peptide that consists of glycine, hydroxyproline, and proline. It is characterized by its unique amino acid composition, which contributes to its structural and functional properties. Gly-hydroxy-pro is often studied for its role in biological systems, particularly in collagen synthesis and stability, due to the presence of hydroxyproline, which is critical for the stability of collagen triple helices. This compound may exhibit properties such as solubility in water, depending on the pH and concentration, and it can participate in various biochemical reactions. Additionally, it may have applications in pharmaceuticals, cosmetics, and food industries, particularly in formulations aimed at promoting skin health and tissue repair. Its specific characteristics, such as molecular weight and structural conformation, can influence its biological activity and interactions with other molecules. Overall, gly-hydroxy-pro is an important compound in biochemistry and materials science.
Formula:C7H12N2O4
InChI:InChI=1/C7H12N2O4/c8-2-6(11)9-3-4(10)1-5(9)7(12)13/h4-5,10H,1-3,8H2,(H,12,13)
- Synonyms:
- Glycyl-4-hydroxyproline
- Gly-4-hydroxy-pro
- Gly-hyp
- Nsc 89599
- L-Proline, 1-glycyl-4-hydroxy-, trans-
- glycyl-4-hydroxy-L-proline
- H-Gly-Hyp-OH
