CAS 24587-37-9
:val-trp
Description:
Val-Trp, or Valine-Tryptophan, is a dipeptide composed of the amino acids valine and tryptophan linked by a peptide bond. It is represented by the CAS number 24587-37-9. This compound is characterized by its hydrophobic nature due to the presence of valine, which is a non-polar amino acid, and tryptophan, which has a bulky aromatic side chain. Val-Trp is known for its potential biological activities, including roles in protein synthesis and modulation of various physiological processes. The structure of Val-Trp allows for specific interactions in biological systems, making it of interest in fields such as biochemistry and pharmacology. Additionally, it may exhibit antioxidant properties and influence neurotransmitter activity due to the presence of tryptophan, a precursor to serotonin. As with many peptides, its stability and solubility can be influenced by environmental factors such as pH and temperature, which are important considerations in both research and potential therapeutic applications.
Formula:C16H21N3O3
InChI:InChI=1/C16H21N3O3/c1-9(2)14(17)15(20)19-13(16(21)22)7-10-8-18-12-6-4-3-5-11(10)12/h3-6,8-9,13-14,18H,7,17H2,1-2H3,(H,19,20)(H,21,22)/t13-,14-/m0/s1
SMILES:CC(C)[C@@H](C(=N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)O)N
Synonyms:- H-Val-Trp-OH
- L-Valyl-L-tryptophan
- Dipeptide-2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
H-Val-Trp-OH
CAS:The dipeptide Val-Trp is a potent, competitive dipeptide angiotensin I-converting enzyme inhibitor with a Ki of 0.3 µM. Dipeptide-2 is a component of various cosmetic formulations, e.g. for anti-wrinkle and anti-aging cosmetics.Formula:C16H21N3O3Purity:> 99%Color and Shape:White PowderMolecular weight:303.36L-Tryptophan, L-valyl-
CAS:Formula:C16H21N3O3Purity:95%Color and Shape:SolidMolecular weight:303.3562N-Valyltryptophan
CAS:N-Valyltryptophan (Val-trp) is an incomplete breakdown product of protein catabolism or protein digestion.Formula:C16H21N3O3Purity:97.52%Color and Shape:SolidMolecular weight:303.36H-Val-Trp-OH
CAS:H-Val-Trp-OH is a noncompetitive inhibitor of the enzyme tyrosinase, which plays a role in melanin production. It also has radical scavenging activities and can inhibit the activity of other enzymes such as glucose 6-phosphate dehydrogenase and acetylcholinesterase. The compound is stable in aqueous solution and can be used to study the effects of H-Val-Trp-OH on wheat germ cells. It is composed of an amino acid sequence that resembles tyrosine, with a carboxylate group attached to the hydroxyl group at position 3. H-Val-Trp-OH is most active against tyrosinase when it is in its activated form, but it can also act as an inhibitor when it is not activated. The compound inhibits the activity of tyrosinase by binding to its active site and blocking the binding or catalysis of substrate molecules. This inhibition occurs through competitive interactions withFormula:C16H21N3O3Purity:Min. 95%Color and Shape:PowderMolecular weight:303.36 g/mol





