CymitQuimica logo

CAS 24589-89-7

:

(4-bromo-2-formylphenoxy)acetic acid

Description:
(4-bromo-2-formylphenoxy)acetic acid is an organic compound characterized by its functional groups and structural features. It contains a phenoxy group, which is a phenol derivative where a hydrogen atom is replaced by an acetic acid moiety. The presence of a bromine atom at the para position and a formyl group at the ortho position relative to the ether linkage contributes to its reactivity and potential applications in organic synthesis. This compound is typically a white to off-white solid and is soluble in polar organic solvents. Its chemical properties are influenced by the electron-withdrawing effects of the bromine and formyl groups, which can enhance its acidity and reactivity in various chemical reactions. (4-bromo-2-formylphenoxy)acetic acid may be utilized in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H7BrO4
InChI:InChI=1/C9H7BrO4/c10-7-1-2-8(6(3-7)4-11)14-5-9(12)13/h1-4H,5H2,(H,12,13)
InChI key:KXRYNWDCFUKVNN-UHFFFAOYSA-N
SMILES:c1cc(c(cc1Br)C=O)OCC(=O)O
Synonyms:
  • Acetic Acid, 2-(4-Bromo-2-Formylphenoxy)-
Found 5 products.