CAS 24589-98-8

methyl 4-formyl-3-hydroxybenzoate

Description:

Methyl 4-formyl-3-hydroxybenzoate, with the CAS number 24589-98-8, is an organic compound that belongs to the class of benzoates. It features a methyl ester functional group, a formyl group, and a hydroxyl group attached to a benzene ring, which contributes to its reactivity and potential applications. The compound is characterized by its aromatic structure, which typically imparts stability and unique chemical properties. It is soluble in organic solvents and may exhibit moderate solubility in water due to the presence of the hydroxyl group. Methyl 4-formyl-3-hydroxybenzoate can participate in various chemical reactions, including esterification and oxidation, making it useful in synthetic organic chemistry. Additionally, its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of more complex molecules. As with many organic compounds, safety precautions should be observed when handling this substance, including the use of appropriate personal protective equipment.

Formula: C₉H₈O₄

InChI: InChI=1/C9H8O4/c1-13-9(12)6-2-3-7(5-10)8(11)4-6/h2-5,11H,1H3

SMILES: COC(=O)c1ccc(C=O)c(c1)O

Benzoic acid, 4-formyl-3-hydroxy-, methyl ester

CAS: 24589-98-8

Formula: C₉H₈O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 180.1574

Ref: IN-DA002OO9

Methyl 4-formyl-3-hydroxybenzoate

CAS: 24589-98-8

Methyl 4-formyl-3-hydroxybenzoate

Purity: 98%

Molecular weight: 180.16g/mol

Ref: 54-OR75013

Methyl 4-formyl-3-hydroxybenzoate

CAS: 24589-98-8

Formula: C₉H₈O₄

Purity: 95%

Color and Shape: Liquid, No data available.

Molecular weight: 180.159

Ref: 10-F545018

4-Carbomethoxysalicylaldehyde

Controlled Product

CAS: 24589-98-8

Formula: C₉H₈O₄

Color and Shape: Neat

Molecular weight: 180.157

Ref: TR-C177725

methyl 4-formyl-3-hydroxybenzoate

CAS: 24589-98-8

Methyl 4-formyl-3-hydroxybenzoate is a versatile compound used as an intermediate in various industries. It is commonly used in coatings, fatty acid synthesis, and glycoprotein modification. This compound contains methyl and hydrogen groups that can undergo transfer reactions, making it useful in the production of methyl ketones and inhibitors. Methyl 4-formyl-3-hydroxybenzoate is also known for its nucleophilic properties, allowing it to participate in acetylation and other chemical reactions. With its unique structure and diverse applications, this compound plays a crucial role in the synthesis of heteroaromatic compounds and glycan modifications.

Formula: C₉H₈O₄

Purity: Min. 95%

Molecular weight: 180.2 g/mol

Ref: 3D-ZAA58998