CAS 24593-59-7
:L-histidine benzyl ester di-P-*toluenesulfonate
Description:
L-histidine benzyl ester di-P-toluenesulfonate is a chemical compound that serves as a derivative of the amino acid L-histidine, modified to enhance its solubility and stability. This compound features a benzyl ester group attached to the amino acid, which can influence its biological activity and interactions. The presence of two P-toluenesulfonate groups enhances its solubility in organic solvents and may facilitate its use in various chemical reactions or biological applications. Typically, compounds like this are utilized in peptide synthesis, drug formulation, or as intermediates in organic synthesis. The di-P-toluenesulfonate moiety also suggests that the compound may exhibit properties such as increased ionic character, which can affect its behavior in solution. Additionally, L-histidine itself is known for its role in protein synthesis and as a precursor for histamine, indicating that derivatives like this may have potential applications in pharmaceuticals or biochemistry. As with any chemical, handling should be done with care, following appropriate safety protocols.
Formula:C27H31N3O8S2
InChI:InChI=1/C13H15N3O2.2C7H8O3S/c14-12(6-11-7-15-9-16-11)13(17)18-8-10-4-2-1-3-5-10;2*1-6-2-4-7(5-3-6)11(8,9)10/h1-5,7,9,12H,6,8,14H2,(H,15,16);2*2-5H,1H3,(H,8,9,10)/t12-;;/m0../s1
Synonyms:- benzyl (2S)-2-amino-3-(1H-imidazol-4-yl)propanoate
- 4-methylbenzenesulfonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
L-Histidine, phenylmethyl ester, 4-methylbenzenesulfonate (1:2)
CAS:Formula:C27H31N3O8S2Purity:97%Color and Shape:SolidMolecular weight:589.6803L-Histidine benzyl ester bistosylate
CAS:L-Histidine benzyl ester bistosylatePurity:≥98%Molecular weight:589.68g/molL-Histidine benzyl ester bistosylate
CAS:<p>L-Histidine benzyl ester bistosylate may serve as an activator for HutP, an RNA-binding protein.</p>Formula:C27H31N3O8S2Purity:98.80%Color and Shape:SolidMolecular weight:589.68


