CAS 24598-73-0
:4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, potassium salt (1:1)
Description:
4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, potassium salt (1:1), commonly referred to as potassium 4-pyrimidinecarboxylate, is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a carboxylic acid functional group, contributing to its acidic properties, and is further modified by the presence of a tetrahydro structure, indicating saturation in part of the ring system. As a potassium salt, it exhibits solubility in water, which is typical for many salts, and it may participate in various chemical reactions, including those involving coordination with metal ions or acting as a ligand. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and role in metabolic pathways. Its stability, reactivity, and solubility characteristics make it a valuable substance for research and application in synthetic chemistry.
Formula:C5H4N2O4·K
InChI:InChI=1S/C5H4N2O4.K/c8-3-1-2(4(9)10)6-5(11)7-3;/h1H,(H,9,10)(H2,6,7,8,11);
InChI key:InChIKey=UYAAZZRQDKUSCS-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=O)NC(=O)N1.[K]
Synonyms:- 4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, monopotassium salt
- 4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, potassium salt (1:1)
- Ba 2658
- Dioron
- Oropur
- Orotic acid potassium salt
- Orotic acid, monopotassium salt
- Potassium 2,6-Dioxo-1,2,3,6-Tetrahydropyrimidine-4-Carboxylate
- Potassium orotate
- Uracil-4-carboxylic acid potassium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Pyrimidinecarboxylic acid, 1,2,3,6-tetrahydro-2,6-dioxo-, potassium salt (1:1)
CAS:Formula:C5H3KN2O4Purity:98%Color and Shape:SolidMolecular weight:194.1866Orotic acid potassium salt
CAS:Formula:C5H3N2O4KPurity:≥ 98.0%Color and Shape:White to pale yellow powderMolecular weight:194.19Orotic acid potassium
CAS:Orotic acid (potassium salt) serves as a biochemical reagent, applicable as both a biological material and an organic compound in life science research.Formula:C5H3KN2O4Color and Shape:SolidMolecular weight:194.19Potassium Orotate
CAS:Controlled ProductApplications Potassium orotate (cas# 24598-73-0) is a useful research chemical.
Formula:C5H3N2O4KColor and Shape:NeatMolecular weight:194.19





