CAS 24599-25-5
:Acryloylglycine
Description:
Acryloylglycine, with the CAS number 24599-25-5, is an organic compound characterized by its dual functional groups: an acryloyl group and a glycine moiety. This compound typically appears as a white to off-white solid and is soluble in water and various organic solvents, making it versatile for different applications. Acryloylglycine is known for its ability to undergo polymerization, particularly in the presence of free radicals, which allows it to be utilized in the synthesis of hydrogels and other polymeric materials. Its structure includes an amine group, which can participate in various chemical reactions, enhancing its reactivity. Additionally, acryloylglycine has potential applications in biomedical fields, such as drug delivery systems and tissue engineering, due to its biocompatibility and ability to form stable networks. Safety considerations should be taken into account when handling this compound, as it may pose irritant effects. Overall, acryloylglycine is a significant compound in both academic research and industrial applications due to its unique chemical properties.
Formula:C5H7NO3
InChI:InChI=1S/C5H7NO3/c1-2-4(7)6-3-5(8)9/h2H,1,3H2,(H,6,7)(H,8,9)
InChI key:InChIKey=LZCXCXDOGAEFQX-UHFFFAOYSA-N
SMILES:C(NCC(O)=O)(C=C)=O
Synonyms:- 2-(Prop-2-enamido)acetic acid
- 2-Acrylamidoacetic acid
- 2-Propenamidoacetic acid
- Acryloylaminoacetic acid
- Acryloylglycine
- Glycine acrylamide
- Glycine, N-(1-oxo-2-propenyl)-
- Glycine, N-acryloyl-
- N-(1-Oxo-2-propen-1-yl)glycine
- N-(1-oxo-2-propenyl)-Glycine
- N-(Carboxymethyl)acrylamide
- N-acryloyl-Glycine
- NSC 288735
- glycine, N-(1-oxo-2-propen-1-yl)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Glycine, N-(1-oxo-2-propen-1-yl)-
CAS:Formula:C5H7NO3Purity:97%Color and Shape:SolidMolecular weight:129.11402-(Prop-2-enamido)acetic acid
CAS:2-(Prop-2-enamido)acetic acidPurity:97%Molecular weight:129.11g/molAcryloylglycine
CAS:Controlled ProductStability Light Sensitive
Applications Acryloylglycine is a vinyl monomer containing an amido and carboxylic group that is used in various industries (pharmaceutical, food, cosmetic) as a synthetic intermediate. Acryloylglycine is also used in biology to preserve the integrity of microorganisms.
References Barbucci, R., et al.: Polymer, 30, 1751 (1989); Lv, Z., et al.: Acta Cryst. E: Struc. Rep. Onl., 62, o3344 (2006); Ringeard, J., et al.: J. Appl. Polym., Sci., 130, 835 (2013)Formula:C5H7NO3Color and Shape:NeatMolecular weight:129.11Acryloylglycine
CAS:Acryloylglycine is a versatile compound that acts as an inhibitor for various processes. It inhibits the synthesis of fatty acids by blocking the activity of key enzymes involved in their production. Additionally, acryloylglycine has been found to inhibit the binding of antibodies to glycoproteins, thus preventing immune responses mediated by these interactions. Furthermore, it has been shown to inhibit the growth of certain bacteria and has potential as an antibiotic agent. Acryloylglycine also plays a role in research as it can be used as a building block for the synthesis of other compounds, such as acid ethyl ester or oligosaccharides. Lastly, acryloylglycine has been investigated for its effects on dopamine receptors and its potential in modulating neurotransmitter activity.Formula:C5H7NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:129.11 g/mol




