CAS 2461-06-5

1-Propanamine, 3-(2-chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-, hydrochloride, (E)-

Description:

1-Propanamine, 3-(2-chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-, hydrochloride, (E)- is a chemical compound characterized by its amine functional group and a thioxanthene moiety, which contributes to its unique properties. The presence of the chloro substituent enhances its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The (E)- configuration indicates the specific geometric arrangement of the double bond in the molecule, which can influence its interaction with biological targets. This compound may exhibit properties such as antimicrobial or antitumor activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with receptors or enzymes, which can be explored in drug development. Safety and handling precautions are essential due to the presence of chlorine and the amine group, which can be reactive and may pose health risks if not managed properly.

Formula: C₁₈H₁₈ClNS·ClH

InChI: InChI=1S/C18H18ClNS.ClH/c1-20(2)11-5-7-14-15-6-3-4-8-17(15)21-18-10-9-13(19)12-16(14)18;/h3-4,6-10,12H,5,11H2,1-2H3;1H/b14-7+;

InChI key: InChIKey=YWKRLOSRDGPEJR-FJUODKGNSA-N

SMILES: C(\CCN(C)C)=C\1/C=2C(SC=3C1=CC=CC3)=CC=C(Cl)C2.Cl

Synonyms:

• trans-Chlorprothixene hydrochloride
• Thioxanthene-Δ9,γ-propylamine, 2-chloro-N,N-dimethyl-, hydrochloride, (E)-
• 9H-Thioxanthene, 1-propanamine deriv.
• 1-Propanamine, 3-(2-chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-, hydrochloride, (E)-

Chlorprothixene EP Impurity F HCl

CAS: 2461-06-5

Formula: C₁₈H₁₈ClNS·HCl

Color and Shape: White To Off-White Solid

Molecular weight: 315.86 36.46

Ref: 4Z-C-335002