
CAS 2461-06-5
:1-Propanamine, 3-(2-chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-, hydrochloride, (E)-
Description:
1-Propanamine, 3-(2-chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-, hydrochloride, (E)- is a chemical compound characterized by its amine functional group and a thioxanthene moiety, which contributes to its unique properties. The presence of the chloro substituent enhances its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The (E)- configuration indicates the specific geometric arrangement of the double bond in the molecule, which can influence its interaction with biological targets. This compound may exhibit properties such as antimicrobial or antitumor activity, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with receptors or enzymes, which can be explored in drug development. Safety and handling precautions are essential due to the presence of chlorine and the amine group, which can be reactive and may pose health risks if not managed properly.
Formula:C18H18ClNS·ClH
InChI:InChI=1S/C18H18ClNS.ClH/c1-20(2)11-5-7-14-15-6-3-4-8-17(15)21-18-10-9-13(19)12-16(14)18;/h3-4,6-10,12H,5,11H2,1-2H3;1H/b14-7+;
InChI key:InChIKey=YWKRLOSRDGPEJR-FJUODKGNSA-N
SMILES:C(\CCN(C)C)=C\1/C=2C(SC=3C1=CC=CC3)=CC=C(Cl)C2.Cl
Synonyms:- trans-Chlorprothixene hydrochloride
- Thioxanthene-Δ9,γ-propylamine, 2-chloro-N,N-dimethyl-, hydrochloride, (E)-
- 9H-Thioxanthene, 1-propanamine deriv.
- 1-Propanamine, 3-(2-chloro-9H-thioxanthen-9-ylidene)-N,N-dimethyl-, hydrochloride, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Chlorprothixene EP Impurity F HCl
CAS:Formula:C18H18ClNS·HClColor and Shape:White To Off-White SolidMolecular weight:315.86 36.46
