CAS 24610-33-1

7-methoxy-1H-indole-2-carboxylic acid

Description:

7-Methoxy-1H-indole-2-carboxylic acid, with the CAS number 24610-33-1, is an organic compound that belongs to the indole family, characterized by a fused bicyclic structure containing a benzene ring and a pyrrole ring. This compound features a methoxy group (-OCH3) at the 7-position and a carboxylic acid group (-COOH) at the 2-position of the indole structure. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid functional group. The methoxy group enhances its lipophilicity and may influence its biological activity. This compound is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential pharmacological properties. It may exhibit activities such as anti-inflammatory or antioxidant effects, although specific biological data would depend on experimental studies. As with many indole derivatives, it may also serve as a precursor for the synthesis of more complex molecules in organic synthesis.

Formula: C₁₀H₉NO₃

InChI: InChI=1/C10H9NO3/c1-14-8-4-2-3-6-5-7(10(12)13)11-9(6)8/h2-5,11H,1H3,(H,12,13)

SMILES: COc1cccc2cc(C(=O)O)[nH]c12

Synonyms:

• 1H-indole-2-carboxylic acid, 7-methoxy-
• 7-Methoxy-1H-indole-2-carboxylic acid

1H-Indole-2-carboxylic acid, 7-methoxy-

CAS: 24610-33-1

Formula: C₁₀H₉NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 191.1834

Ref: IN-DA002ORU

7-Methoxy-1H-indole-2-carboxylic acid

CAS: 24610-33-1

7-Methoxy-1H-indole-2-carboxylic acid

Purity: 98%

Ref: 54-OR1041186

7-Methoxy-1H-indole-2-carboxylic acid

CAS: 24610-33-1

Formula: C₁₀H₉NO₃

Purity: 98%

Molecular weight: 191.186

Ref: 10-F243080

7-Methoxy-1H-indole-2-carboxylic acid

CAS: 24610-33-1

7-Methoxy-1H-indole-2-carboxylic acid is a compound with diverse applications. It acts as a pyrazole and dihydroorotate dehydrogenase inhibitor, making it useful in the field of medicinal chemistry and drug discovery. Additionally, it has been studied for its potential retinoid activity, which could have implications in skincare and dermatology.

Formula: C₁₀H₉NO₃

Purity: Min. 95%

Molecular weight: 191.18 g/mol

Ref: 3D-ZAA61033