CAS 24613-06-7

4,4'-(2R)-propane-1,2-diyldipiperazine-2,6-dione

Description:

4,4'-(2R)-propane-1,2-diyldipiperazine-2,6-dione, with the CAS number 24613-06-7, is a chemical compound characterized by its dual piperazine structure, which contributes to its potential biological activity. This compound features a propane-1,2-diyl linker connecting two piperazine rings, each containing a dione functional group at the 2 and 6 positions. The presence of these dione groups suggests that the compound may exhibit reactivity typical of diketones, such as the ability to participate in condensation reactions or act as electrophiles. The stereochemistry indicated by the (2R) designation implies that the compound has specific spatial arrangements that could influence its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can be influenced by its functional groups and overall molecular structure, which may affect its applications in pharmaceuticals or as a research chemical. Further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₁H₁₆N₄O₄

InChI: InChI=1/C11H16N4O4/c1-7(15-5-10(18)13-11(19)6-15)2-14-3-8(16)12-9(17)4-14/h7H,2-6H2,1H3,(H,12,16,17)(H,13,18,19)/t7-/m1/s1

SMILES: C[C@H](CN1CC(=NC(=O)C1)O)N1CC(=NC(=O)C1)O

(R)-Razoxane (Levrazoxane)

CAS: 24613-06-7

Formula: C₁₁H₁₆N₄O₄

Color and Shape: Pale Brown Solid

Molecular weight: 268.27

Ref: 4Z-R-088006

Dexrazoxane R-Isomer

CAS: 24613-06-7

Formula: C₁₁H₁₆N₄O₄

Molecular weight: 268.27

Ref: ST-EA-CP-D149002

Razoxane, (R)-

CAS: 24613-06-7

Razoxane, (R)- shows antiangiogenic effects.

Formula: C₁₁H₁₆N₄O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 268.27

Ref: TM-T26047