CAS 24613-12-5

L-Tryptophyl-L-valine

Description:

L-Tryptophyl-L-valine, with the CAS number 24613-12-5, is a dipeptide composed of the amino acids L-tryptophan and L-valine. This compound exhibits characteristics typical of peptides, including the presence of an amide bond formed between the carboxyl group of one amino acid and the amino group of another. L-Tryptophyl-L-valine is generally soluble in water and exhibits a specific molecular structure that contributes to its biological activity. It may play a role in various physiological processes, including protein synthesis and neurotransmitter regulation, due to the involvement of its constituent amino acids in metabolic pathways. The presence of tryptophan, an essential amino acid, is particularly noteworthy as it is a precursor to serotonin, a key neurotransmitter. Additionally, the hydrophobic nature of valine can influence the peptide's interactions in biological systems. Overall, L-Tryptophyl-L-valine is of interest in biochemical research and potential therapeutic applications, particularly in the fields of nutrition and neurobiology.

Formula: C₁₆H₂₁N₃O₃

InChI: InChI=1/C16H21N3O3/c1-9(2)14(16(21)22)19-15(20)12(17)7-10-8-18-13-6-4-3-5-11(10)13/h3-6,8-9,12,14,18H,7,17H2,1-2H3,(H,19,20)(H,21,22)/t12-,14-/m0/s1

SMILES: CC(C)[C@@H](C(=O)O)N=C([C@H](Cc1c[nH]c2ccccc12)N)O

Synonyms:

• H-Trp-Val-OH
• (2S)-2-{[(2S)-2-ammonio-3-(1H-indol-3-yl)propanoyl]amino}-3-methylbutanoate

H-Trp-Val-OH

CAS: 24613-12-5

As tryptophan and the dipeptide Val-Trp (N-1170), Trp-Val, and was shown to be an effective non-competitive inhibitor of xanthine oxidase. Trp-Val also inhibited DPP IV, contrary to the inverse dipeptide.

Formula: C₁₆H₂₁N₃O₃

Purity: > 98%

Color and Shape: White Powder

Molecular weight: 303.36

Ref: 01-4031217

H-Trp-Val-OH

CAS: 24613-12-5

Formula: C₁₆H₂₁N₃O₃

Molecular weight: 303.3562

Ref: IN-DA002ORK

H-Trp-Val-OH

CAS: 24613-12-5

H-Trp-Val-OH is a human protein that has been shown to be involved in the uptake of glucose into cells. H-Trp-Val-OH is also known as colony stimulating factor 1, which stimulates the growth and differentiation of hematopoietic cells. It has been shown to play a role in weight gain, insulin resistance, and type 2 diabetes. This monoclonal antibody has not been found to have any long term toxicity or genotoxicity in animal studies.

Formula: C₁₆H₂₁N₃O₃

Purity: Min. 95%

Molecular weight: 303.36 g/mol

Ref: 3D-FT108204