CAS 246139-77-5

2-Bromo-4-(1,1-dimethylethyl)benzaldehyde

Description:

2-Bromo-4-(1,1-dimethylethyl)benzaldehyde is an organic compound characterized by its aromatic structure, featuring a bromine atom and a bulky tert-butyl group attached to a benzaldehyde moiety. The presence of the bromine substituent enhances its reactivity, making it useful in various synthetic applications, including the formation of carbon-carbon bonds. The tert-butyl group contributes to the compound's steric hindrance, influencing its reactivity and interactions with other molecules. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in organic solvents, such as dichloromethane and ether, but has limited solubility in water due to its hydrophobic characteristics. 2-Bromo-4-(1,1-dimethylethyl)benzaldehyde can be utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, owing to its functional groups that allow for further chemical modifications. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C₁₁H₁₃BrO

InChI: InChI=1S/C11H13BrO/c1-11(2,3)9-5-4-8(7-13)10(12)6-9/h4-7H,1-3H3

InChI key: InChIKey=WVCSDKHZXVXDMV-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C1=CC(Br)=C(C=O)C=C1

Synonyms:

• 2-Bromo-4-(1,1-dimethylethyl)benzaldehyde
• 2-Bromo-4-tert-butylbenzaldehyde
• 4-(tert-Butyl)-2-bromobenzaldehyde
• Benzaldehyde, 2-bromo-4-(1,1-dimethylethyl)-

Benzaldehyde, 2-bromo-4-(1,1-dimethylethyl)-

CAS: 246139-77-5

Formula: C₁₁H₁₃BrO

Purity: 97%

Molecular weight: 241.1243

Ref: IN-DA002ORC

2-Bromo-4-tert-Butylbenzaldehyde

CAS: 246139-77-5

Purity: ≥95%

Molecular weight: 241.128006

Ref: 10-F639736

2-Bromo-4-tert-butylbenzaldehyde

CAS: 246139-77-5

2-Bromo-4-tert-butylbenzaldehyde (2BBBA) is an active natural product that is used in the synthesis of tetrabromomethane. 2BBBA can be synthesized from 2,4-dichlorobenzaldehyde and bromine gas. This reaction is called a Corey-Fuchs reaction. The synthesis of this compound involves the conversion of a terminal alkene to an aldehyde followed by olefination with the bromide ion. The Corey-Fuchs reaction involves the addition of an organohalogen to an unsaturated carbon atom in an organic molecule to form a new carbon-carbon bond.

Formula: C₁₁H₁₃BrO

Purity: Min. 95%

Molecular weight: 241.12 g/mol

Ref: 3D-WJA13977