CAS 24621-70-3

1H-indol-2-ylmethanol

Description:

1H-Indol-2-ylmethanol, with the CAS number 24621-70-3, is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features a hydroxymethyl group (-CH2OH) attached to the second position of the indole ring, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxymethyl group. The compound is of interest in various fields, including medicinal chemistry, due to its potential pharmacological properties, including antimicrobial and anticancer activities. Its structure allows for various chemical modifications, making it a versatile intermediate in organic synthesis. Additionally, 1H-indol-2-ylmethanol can participate in hydrogen bonding, influencing its interactions in biological systems and its behavior in chemical reactions. Overall, this compound serves as a valuable building block in the development of new therapeutic agents.

Formula: C₉H₉NO

InChI: InChI=1/C9H9NO/c11-6-8-5-7-3-1-2-4-9(7)10-8/h1-5,10-11H,6H2

SMILES: c1ccc2c(c1)cc(CO)[nH]2

Synonyms:

• 1H-Indole-2-methanol
• (1H-indol-2-yl)methanol

1H-Indole-2-methanol

CAS: 24621-70-3

Formula: C₉H₉NO

Purity: 96%

Color and Shape: Solid

Molecular weight: 147.1739

Ref: IN-DA002OTW

1H-Indole-2-methanol

CAS: 24621-70-3

Formula: C₉H₉NO

Purity: ≥ 97.0%

Color and Shape: White to light yellow or tan crystalline powder

Molecular weight: 147.17

Ref: 7W-GX4171

2-(Hydroxymethyl)-1H-indole

CAS: 24621-70-3

2-(Hydroxymethyl)-1H-indole

Formula: C₉H₉NO

Purity: 97%

Color and Shape: pale-yellow solid

Molecular weight: 147.17386g/mol

Ref: 54-OR20024

(1H-Indol-2-yl)methanol

CAS: 24621-70-3

Formula: C₉H₉NO

Purity: 96%

Color and Shape: Solid

Molecular weight: 147.177

Ref: 10-F208997

1H-Indol-2-ylmethanol

CAS: 24621-70-3

1H-Indol-2-ylmethanol is a model compound for the synthesis of bioactive molecules. It is used in biological studies as an inhibitor of chronic lymphocytic leukemia, heart disease, and inflammatory pain. The nitro group on 1H-Indol-2-ylmethanol has been shown to activate various enzymes involved in the inflammatory response. The hydroxy group on 1H-Indol-2-ylmethanol has been shown to inhibit cyclooxygenase (COX) enzymes, which are responsible for the production of prostaglandins that cause inflammation.

Formula: C₉H₉NO

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 147.17 g/mol

Ref: 3D-FI61388