CAS 2463-45-8
:Chloromethyl-1,3-dioxolan-2-one
Description:
Chloromethyl-1,3-dioxolan-2-one, with the CAS number 2463-45-8, is a cyclic organic compound characterized by its unique dioxolane structure, which features a five-membered ring containing two oxygen atoms and a carbonyl group. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of the chloromethyl group, which can participate in various nucleophilic substitution reactions. The dioxolane ring contributes to its stability and can influence its solubility in polar solvents. Chloromethyl-1,3-dioxolan-2-one is often utilized in organic synthesis, particularly in the preparation of more complex molecules, including pharmaceuticals and agrochemicals. Its reactivity and functional groups make it a valuable intermediate in chemical reactions. However, handling this compound requires caution due to its potential toxicity and reactivity, necessitating appropriate safety measures in laboratory settings.
Formula:C4H5ClO3
InChI:InChI=1S/C4H5ClO3/c5-1-3-2-7-4(6)8-3/h3H,1-2H2
InChI key:InChIKey=LFEAJBLOEPTINE-UHFFFAOYSA-N
SMILES:C(Cl)C1OC(=O)OC1
Synonyms:- (Chloromethyl)ethylene carbonate
- 1,2-Propanediol, 3-chloro-, cyclic carbonate
- 1,3-Dioxolan-2-one, 4-(chloromethyl)-
- 3-Chloro-1,2-propylene carbonate
- 3-Chloropropene carbonate
- 3-Chloropropylene carbonate
- 4-(Chloromethyl)-1,3-Dioxolan-2-One
- 4-Chloro-1,3-Dioxan-2-One
- 4-Chloromethyl-1,3-dioxol-2-one
- 4-Chloromethyl-2-oxo-1,3-dioxolane
- Carbonic acid, (chloromethyl)ethylene ester
- Carbonic acid, cyclic (chloromethyl)ethylene ester
- Chloromethyl-1,3-dioxolan-2-one
- Cyclic (chloromethyl)ethylene carbonate
- Epichlorohydrin Carbonate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,3-Dioxolan-2-one,4-(chloromethyl)-
CAS:Formula:C4H5ClO3Purity:95%Color and Shape:LiquidMolecular weight:136.53374-(Chloromethyl)-1,3-dioxolan-2-one
CAS:4-(Chloromethyl)-1,3-dioxolan-2-onePurity:98%Molecular weight:136.53g/mol4-(Chloromethyl)-1,3-dioxolan-2-one
CAS:4-(Chloromethyl)-1,3-dioxolan-2-one is a chemical compound that is used as a reagent in organic synthesis. It can be prepared by reacting 4-chloro-2-oxopentanenitrile with formaldehyde. 4-(Chloromethyl)-1,3-dioxolan-2-one has been used in the synthesis of epoxides and other compounds. The reaction mechanism involves an initial nucleophilic attack by chlorine on the electrophilic carbon atom. This leads to the formation of a reactive intermediate which then reacts with another molecule of formaldehyde to form 4-(chloromethyl)-1,3-dioxolan-2-one and release hydrogen chloride gas. Kinetic studies have shown that the rate of this reaction increases with increasing temperature but reaches an optimum at about 60°C. 4-(Chloromethyl)-1,3-dioxolan-2-oneFormula:C4H5ClO3Purity:Min. 95%Color and Shape:PowderMolecular weight:136.53 g/mol



