CAS 2463-49-2
:4-O-methyl-D-glucuronic acid
Description:
4-O-Methyl-D-glucuronic acid is a derivative of glucuronic acid, characterized by the presence of a methoxy group (-OCH3) at the 4-position of the sugar molecule. This modification influences its solubility and reactivity, making it more hydrophobic compared to its parent compound. The substance is typically found in various biological systems, where it plays a role in the metabolism of drugs and xenobiotics, often acting as a conjugate that enhances the excretion of these compounds. Its structure includes a carboxylic acid group, which contributes to its acidic properties, and hydroxyl groups that can participate in hydrogen bonding. The presence of the methoxy group can also affect its interaction with enzymes and receptors. 4-O-Methyl-D-glucuronic acid is of interest in biochemical research and pharmaceutical applications, particularly in the study of glycosylation processes and the development of drug delivery systems. As with many sugar derivatives, it may exhibit various stereoisomers, which can influence its biological activity and interactions.
Formula:C7H12O7
InChI:InChI=1/C7H12O7/c1-14-6(5(11)7(12)13)4(10)3(9)2-8/h2-6,9-11H,1H3,(H,12,13)/t3-,4+,5-,6-/m0/s1
Synonyms:- 4-O-Methyl-Alpha-D-Glucuronic Acid
- 4-O-Methyl-Beta-D-Glucuronic Acid
- D-glucuronic acid, 4-O-methyl-
- 4-O-Methyl-D-glucuronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-O-Methyl-D-glucuronic Acid
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications 4-O-Methyl-D-glucuronic acid (cas# 2463-49-2) is a useful research chemical.<br></p>Formula:C7H12O7Color and Shape:NeatMolecular weight:208.17
