CAS 24631-83-2
:2-hydroxy-8-methyl-4H-chromen-4-one
Description:
2-Hydroxy-8-methyl-4H-chromen-4-one, also known as a derivative of coumarin, is a chemical compound characterized by its chromenone structure, which features a benzopyrone core. This compound typically exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential antimicrobial properties. The presence of the hydroxyl group at the 2-position and the methyl group at the 8-position contributes to its unique reactivity and solubility characteristics. It is often studied for its potential applications in pharmaceuticals and natural product chemistry. The compound is generally soluble in organic solvents and may have limited solubility in water, which is common for many coumarin derivatives. Its molecular structure allows for various interactions with biological targets, making it a subject of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H8O3
InChI:InChI=1/C10H8O3/c1-6-3-2-4-7-8(11)5-9(12)13-10(6)7/h2-5,12H,1H3
SMILES:Cc1cccc2c(=O)cc(O)oc12
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Hydroxy-8-methyl-2H-chromen-2-one
CAS:<p>4-Hydroxy-8-methyl-2H-chromen-2-one is a versatile compound with various applications. It functions as an anticoagulant, inhibiting the clotting of blood. Additionally, it plays a role in ornithine and fatty acid metabolism. This compound is commonly used in the synthesis of carbapenem antibiotics, which are highly effective against bacterial infections. Furthermore, 4-Hydroxy-8-methyl-2H-chromen-2-one has antioxidant properties due to its resemblance to ascorbic acid, making it an excellent ingredient for skincare products. Its ability to inhibit thymidylate synthase makes it valuable in cancer research and treatment. As an extractant, it is utilized to isolate compounds such as saponins and molybdenum from natural sources. 4-Hydroxy-8-methyl-2H-chromen-2-one is widely recognized in the field of research chemicals for its diverse applications and</p>Formula:C10H8O3Purity:Min. 95%Molecular weight:176.17 g/mol


