CAS 2464-37-1
:Chlorflurenol
Description:
Chlorflurenol, with the CAS number 2464-37-1, is a synthetic chemical compound primarily used as a herbicide and plant growth regulator. It belongs to the class of compounds known as chlorophenols, characterized by the presence of chlorine atoms and hydroxyl groups attached to a phenolic structure. Chlorflurenol is recognized for its ability to inhibit the growth of certain weeds while promoting desirable plant growth, making it valuable in agricultural practices. The compound is typically applied in various formulations, including emulsifiable concentrates and granules. Its mode of action involves disrupting the normal growth processes in target plants, leading to their eventual death. Chlorflurenol is generally considered to have low toxicity to mammals, but like many agrochemicals, it should be handled with care to minimize environmental impact. Its stability and effectiveness under various environmental conditions make it a useful tool in crop management, although its use is regulated in many regions to ensure safety and efficacy.
Formula:C14H9ClO3
InChI:InChI=1/C14H9ClO3/c15-8-5-6-10-9-3-1-2-4-11(9)14(18,13(16)17)12(10)7-8/h1-7,18H,(H,16,17)
InChI key:InChIKey=SVOAUHHKPGKPQK-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(O)C=2C(C=3C1=CC=CC3)=CC=C(Cl)C2
Synonyms:- 2-Chloro-9-hydroxy-9H-fluorene-9-carboxylic acid
- 2-Chloro-9-hydroxyfluorene-9-carboxylic acid
- 9H-Fluorene-9-carboxylic acid, 2-chloro-9-hydroxy-
- Chlorflurecol
- Cme 73170P
- Fluorene-9-carboxylic acid, 2-chloro-9-hydroxy-
- It 3299
- NSC 102385
- 2-chloro-9-hydroxy-9h-fluorene-9-carboxylicaci
- 2-chloro-9-hydroxy-fluorene-9-carboxylicaci
- 2-chloro-9-hydroxyflurene-9-carboxylic acid
- CHLORFLURENOL PESTANAL (2-CHLORO-9-HYDR
- chlorflurecol (bsi until 1990,can.,denm.)
- cme73170p
- chlorflurenol (bsi,iso)
- CHLORFLURENOL
- 2-Chlror-9-hydroxy-9-fluorenecarboxylic acid
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
9H-Fluorene-9-carboxylic acid, 2-chloro-9-hydroxy-
CAS:Formula:C14H9ClO3Color and Shape:SolidMolecular weight:260.6725


