CAS 24641-31-4

2-(4-bromophenyl)quinoline

Description:

2-(4-Bromophenyl)quinoline is an organic compound characterized by its quinoline backbone substituted with a bromophenyl group at the 2-position. This compound typically exhibits a pale yellow to brownish color and is known for its aromatic properties due to the presence of both the quinoline and bromobenzene moieties. It has a relatively high melting point and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dichloromethane, but may have limited solubility in water. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 2-(4-bromophenyl)quinoline may exhibit biological activity, including potential antimicrobial or anticancer properties, which makes it of interest in medicinal chemistry. Its structure allows for various substitution reactions, enabling further functionalization for specific applications in research and industry.

Formula: C₁₅H₁₀BrN

InChI: InChI=1/C15H10BrN/c16-13-8-5-12(6-9-13)15-10-7-11-3-1-2-4-14(11)17-15/h1-10H

SMILES: c1ccc2c(c1)ccc(c1ccc(cc1)Br)n2

Synonyms:

• Quinoline, 2-(4-Bromophenyl)-

Quinoline, 2-(4-bromophenyl)-

CAS: 24641-31-4

Formula: C₁₅H₁₀BrN

Purity: 95%

Color and Shape: Solid

Molecular weight: 284.1506

Ref: IN-DA002OWH

2-(4-Bromophenyl)quinoline

CAS: 24641-31-4

2-(4-Bromophenyl)quinoline

Purity: 95%

Molecular weight: 284.16g/mol

Ref: 54-OR1053952

2-(4-Bromophenyl)quinoline

CAS: 24641-31-4

Purity: 95.0%

Molecular weight: 284.156005859375

Ref: 10-F431280