CAS 2465-91-0

3-{3-(2-cyanoethoxy)-2,2-bis[(2-cyanoethoxy)methyl]propoxy}propanenitrile

Description:

3-{3-(2-Cyanoethoxy)-2,2-bis[(2-cyanoethoxy)methyl]propoxy}propanenitrile, with the CAS number 2465-91-0, is a complex organic compound characterized by its multiple functional groups, including cyano and ether functionalities. This substance features a propanenitrile backbone, which contributes to its potential reactivity and solubility properties. The presence of cyano groups suggests that it may exhibit polar characteristics, making it soluble in polar solvents. The ether linkages provide stability and can influence the compound's physical properties, such as boiling and melting points. Additionally, the branched structure may affect its steric hindrance and overall molecular interactions. This compound may be of interest in various applications, including pharmaceuticals, agrochemicals, or materials science, due to its unique structural features. However, specific safety and handling guidelines should be followed, as compounds with cyano groups can be toxic and require careful management in laboratory settings.

Formula: C₁₇H₂₄N₄O₄

InChI: InChI=1/C17H24N4O4/c18-5-1-9-22-13-17(14-23-10-2-6-19,15-24-11-3-7-20)16-25-12-4-8-21/h1-4,9-16H2

SMILES: C(C#N)COCC(COCCC#N)(COCCC#N)COCCC#N

Tetra(cyanoethoxymethyl) methane

CAS: 2465-91-0

Tetra(cyanoethoxymethyl) methane

Purity: 99+%

Molecular weight: 348.4g/mol

Ref: 54-OR1043007

Tetra(cyanoethoxymethyl) methane

CAS: 2465-91-0

Tetra(cyanoethoxymethyl) methane is an alkyl chain-derived PROTAC linker suitable for synthesizing PROTACs[1].

Formula: C₁₇H₂₄N₄O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 348.4

Ref: TM-T17046

Tetra(cyanoethoxymethyl) methane

CAS: 2465-91-0

Purity: 99+%

Molecular weight: 348.4030151

Ref: 10-F604471

Tetra(cyanoethoxymethyl) methane

CAS: 2465-91-0

Tetra(cyanoethoxymethyl) methane is a solvent, which is used in electroluminescent devices. It is an organic solute that has been shown to react with alkali metals to form a particle. This reaction system can be used as a corrosion inhibitor for devices and metal ions, such as copper and iron ions. The light emission from these reactions is due to the inorganic compounds of copper (Cu) and iron (Fe), which are fluorescent. The structural formula of tetra(cyanoethoxymethyl) methane is C8H18N2O4COxCH3. The low molecular weight and reactive properties of this compound make it ideal for use in electroluminescent devices, where it has been shown to have a reaction time of less than 10 seconds, leading to efficient light emission.

Formula: C₁₇H₂₄N₄O₄

Purity: 90%Min

Molecular weight: 348.4 g/mol

Ref: 3D-CAA46591