CAS 24654-08-8

3-(2-chlorophenyl)prop-2-ynoic acid

Description:

3-(2-Chlorophenyl)prop-2-ynoic acid, with the CAS number 24654-08-8, is an organic compound characterized by its unique structure, which includes a propyne moiety and a chlorophenyl group. This compound features a triple bond between the second and third carbon atoms of the prop-2-ynoic acid backbone, contributing to its reactivity and potential applications in organic synthesis. The presence of the 2-chlorophenyl group enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature can exhibit various properties such as acidity due to the carboxylic acid functional group, and they may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing effect of the chlorine atom. Additionally, 3-(2-chlorophenyl)prop-2-ynoic acid may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals, highlighting its importance in chemical research and industry. Its physical properties, such as solubility and melting point, would depend on the specific conditions and purity of the sample.

Formula: C₉H₅ClO₂

InChI: InChI=1/C9H5ClO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,(H,11,12)

SMILES: c1ccc(c(c1)C#CC(=O)O)Cl

Synonyms:

• 2-Propynoic Acid, 3-(2-Chlorophenyl)-

3-(2-Chlorophenyl)prop-2-ynoic acid

CAS: 24654-08-8

3-(2-Chlorophenyl)prop-2-ynoic acid

Purity: 97%

Molecular weight: 180.59g/mol

Ref: 54-OR1036124

3-(2-chlorophenyl)prop-2-ynoic acid

CAS: 24654-08-8

Formula: C₉H₅ClO₂

Purity: 97%

Molecular weight: 180.59

Ref: 10-F522353

3-(2-Chlorophenyl)prop-2-ynoic acid

CAS: 24654-08-8

Versatile small molecule scaffold

Formula: C₉H₅ClO₂

Purity: Min. 95%

Molecular weight: 180.59 g/mol

Ref: 3D-ZAA65408