CAS 24654-48-6

4-Fluorofinnamonitrile

Description:

4-Fluorofinnamonitrile, with the CAS number 24654-48-6, is an organic compound characterized by the presence of a fluorine atom and a nitrile functional group attached to a cinnamyl structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It has a molecular formula that reflects its structure, which includes a phenyl ring, a double bond, and a cyano group. The presence of the fluorine atom can influence its reactivity and polarity, making it useful in various chemical syntheses and applications, particularly in pharmaceuticals and agrochemicals. 4-Fluorofinnamonitrile is known for its potential as an intermediate in the synthesis of more complex molecules, and its unique electronic properties may enhance its utility in materials science. As with many nitriles, it may exhibit toxicity and should be handled with appropriate safety precautions in a controlled laboratory environment.

Formula: C₉H₆FN

InChI: InChI=1/C9H6FN/c10-9-5-3-8(4-6-9)2-1-7-11/h1-6H/b2-1+

Synonyms:

• 4-Fluorocinnamonitrile
• (2E)-3-(4-fluorophenyl)prop-2-enenitrile

2-PROPENENITRILE, 3-(4-FLUOROPHENYL)-

CAS: 24654-48-6

Formula: C₉H₆FN

Purity: 99%

Color and Shape: Liquid

Molecular weight: 147.1490

Ref: IN-DA002OYI

4-Fluorocinnamonitrile

CAS: 24654-48-6

4-Fluorocinnamonitrile

Purity: 97%

Molecular weight: 147.15g/mol

Ref: 54-PC10410

4-Fluorocinnamonitrile

CAS: 24654-48-6

Formula: C₉H₆FN

Purity: 99.0%

Color and Shape: Solid

Molecular weight: 147.152

Ref: 10-F005919