CAS 2466-42-4
:(+)-Neolitsine
Description:
(+)-Neolitsine, with the CAS number 2466-42-4, is an alkaloid derived from various plant sources, particularly those in the family of Amaryllidaceae. This compound is characterized by its complex molecular structure, which includes multiple chiral centers, contributing to its optical activity. As a naturally occurring compound, (+)-Neolitsine exhibits a range of biological activities, including potential anti-inflammatory and analgesic properties, making it of interest in pharmacological research. The substance is typically found in a crystalline form and is soluble in organic solvents, but its solubility in water is limited. Its stereochemistry plays a crucial role in its interaction with biological systems, influencing its efficacy and safety profile. Additionally, (+)-Neolitsine may undergo various chemical reactions, such as oxidation or reduction, which can alter its properties and biological activity. Overall, this compound represents a significant area of study within natural product chemistry and medicinal chemistry due to its potential therapeutic applications.
Formula:C19H17NO4
InChI:InChI=1S/C19H17NO4/c1-20-3-2-10-5-16-19(24-9-23-16)18-12-7-15-14(21-8-22-15)6-11(12)4-13(20)17(10)18/h5-7,13H,2-4,8-9H2,1H3/t13-/m0/s1
InChI key:InChIKey=GKEOKAJRKHTDOS-ZDUSSCGKSA-N
SMILES:CN1[C@@]2(C=3C(C=4C(C2)=CC5=C(C4)OCO5)=C6C(=CC3CC1)OCO6)[H]
Synonyms:- (+)-Neolitsine
- (7aS)-6,7,7a,8-Tetrahydro-7-methyl-5H-bis[1,3]benzodioxolo[6,5,4-de:5′,6′-g]quinoline
- 5H-Bis[1,3]benzodioxolo[6,5,4-de:5',6'-g]quinoline,6,7,7a,8-tetrahydro-7-methyl-, (S)-
- 5H-Bis[1,3]benzodioxolo[6,5,4-de:5′,6′-g]quinoline, 6,7,7a,8-tetrahydro-7-methyl-, (7aS)-
- 5H-Bis[1,3]benzodioxolo[6,5,4-de:5′,6′-g]quinoline, 6,7,7a,8-tetrahydro-7-methyl-, (S)-
- 6aa-Aporphine, 1,2:9,10-bis(methylenedioxy)- (8CI)
- 6aα-Aporphine, 1,2:9,10-bis(methylenedioxy)-
- Neolitsin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5H-Bis[1,3]benzodioxolo[6,5,4-de:5',6'-g]quinoline, 6,7,7a,8-tetrahydro-7-methyl-, (7aS)-
CAS:Formula:C19H17NO4Purity:97.0%Color and Shape:SolidMolecular weight:323.3426Neolitsine
CAS:Neolitsine has anthelmintic activity, it exhibits EC90 values (concentration at which 90% loss of larval motility is observed) of 6.4 microg/mL.Neolitsine andFormula:C19H17NO4Purity:98%Color and Shape:SolidMolecular weight:323.34Neolitsine
CAS:Neolitsine is a synthetic compound that serves as an experimental pharmacological agent, derived primarily from laboratory-based chemical synthesis. It operates through a novel mode of action involving the modulation of specific cellular pathways implicated in pathological conditions. Specifically, Neolitsine targets key signaling cascades, thereby influencing cellular responses that can be beneficial in disease contexts.Formula:C19H17NO4Purity:Min. 95%Molecular weight:323.3 g/mol



