
CAS 24660-23-9
:5,7,12-Trioxa-6-stannadocosa-2,9-dienoic acid, 6,6-dibutyl-4,8,11-trioxo-, decyl ester, (Z,Z)-
Description:
5,7,12-Trioxa-6-stannadocosa-2,9-dienoic acid, 6,6-dibutyl-4,8,11-trioxo-, decyl ester, with CAS number 24660-23-9, is a complex organometallic compound characterized by the presence of tin (stannum) within its structure, which contributes to its unique chemical properties. This compound features multiple functional groups, including ester and trioxo moieties, which can influence its reactivity and solubility. The presence of a long hydrocarbon chain (decyl ester) suggests that it may exhibit amphiphilic behavior, potentially allowing it to interact with both polar and nonpolar environments. The specific arrangement of the oxo groups and the double bonds in the carbon chain indicates that it may participate in various chemical reactions, including oxidation and polymerization. Additionally, the stereochemistry denoted by (Z,Z) implies specific geometric configurations that could affect its biological activity and interactions. Overall, this compound's unique structure and functional groups make it of interest in fields such as materials science, organic synthesis, and potentially in biological applications.
Formula:C36H64O8Sn
InChI:InChI=1S/2C14H24O4.2C4H9.Sn/c2*1-2-3-4-5-6-7-8-9-12-18-14(17)11-10-13(15)16;2*1-3-4-2;/h2*10-11H,2-9,12H2,1H3,(H,15,16);2*1,3-4H2,2H3;/q;;;;+2/p-2/b2*11-10-;;;
InChI key:InChIKey=WPMZBGWYNQCTRW-YFQJWWFYSA-L
SMILES:[Sn](OC(/C=C\C(OCCCCCCCCCC)=O)=O)(OC(/C=C\C(OCCCCCCCCCC)=O)=O)(CCCC)CCCC
Synonyms:- Stannane, dibutylbis[(3-carboxyacryloyl)oxy]-, didecyl ester, (Z,Z)-
- 5,7,12-Trioxa-6-stannadocosa-2,9-dienoic acid, 6,6-dibutyl-4,8,11-trioxo-, decyl ester, (Z,Z)-
- Dibutyltin bis(decyl maleate)
- Maleic acid, monodecyl ester, dibutylstannylene deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,7,12-Trioxa-6-stannadocosa-2,9-dienoic acid, 6,6-dibutyl-4,8,11-trioxo-, decyl ester, (Z,Z)- (9CI)
CAS:Formula:C36H64O8SnMolecular weight:743.5896
