
CAS 24678-65-7
:1H-Azepine-1-carbodithioic acid, hexahydro-, sodium salt (1:1)
Description:
1H-Azepine-1-carbodithioic acid, hexahydro-, sodium salt (1:1) is a chemical compound characterized by its unique structure, which includes a seven-membered azepine ring and functional groups that contribute to its reactivity and solubility. As a sodium salt, it typically exhibits enhanced solubility in aqueous solutions, making it useful in various applications, including as a reagent in organic synthesis or as an intermediate in chemical processes. The presence of carbodithioic acid functionality suggests potential applications in coordination chemistry and as a ligand in metal complexation. Additionally, the hexahydro configuration indicates that the compound is saturated, which may influence its stability and reactivity compared to unsaturated analogs. Safety and handling considerations are essential, as with many chemical substances, and proper precautions should be taken to mitigate any potential hazards associated with its use. Overall, this compound's distinct structural features and properties make it of interest in both academic research and industrial applications.
Formula:C7H13NS2·Na
InChI:InChI=1S/C7H13NS2.Na/c9-7(10)8-5-3-1-2-4-6-8;/h1-6H2,(H,9,10);
InChI key:InChIKey=SGEZZUOVGZUFDS-UHFFFAOYSA-N
SMILES:C(=S)(S)N1CCCCCC1.[Na]
Synonyms:- Sodium hexamethyleneiminecarbodithioate
- 1H-Azepine-1-carbodithioic acid, hexahydro-, sodium salt (1:1)
- Sodium hexamethylenedithiocarbamate
- Sodium hexahydro-1H-azepin-1-ylthiocarbothiolate
- 1H-Azepine-1-carbodithioic acid, hexahydro-, sodium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Sodium (azepane-1-carbothioyl)sulfanide
CAS:Sodium azepane-1-carbothioyl sulfanide (SACS) is a selective spermicide that is used to immobilize and kill sperm cells. It irreversibly binds to the cell membrane of the sperm, causing its death. SACS has been shown to be effective against Trichomonas vaginalis, which causes trichomoniasis in humans. This drug is applied as a cream or foam, and has no effect on other microflora present in the vagina. SACS also has a fluorescent label for visualizing its binding to the cell membrane of sperm.Formula:C7H12NNaS2Purity:Min. 95%Molecular weight:197.3 g/mol
