CAS 2468-21-5: (+)-Catharanthine
Description:(+)-Catharanthine is an alkaloid derived from the plant Catharanthus roseus, commonly known as the Madagascar periwinkle. It is characterized by its complex tetracyclic structure, which includes a quinoline moiety. This compound is known for its biological activity, particularly its role as a precursor in the synthesis of various anticancer agents, such as vincristine and vinblastine. (+)-Catharanthine exhibits a chiral center, making it optically active, and it is typically found in its (+) enantiomeric form. The substance is soluble in organic solvents but has limited solubility in water. Its pharmacological properties include cytotoxicity against certain cancer cell lines, which has garnered interest in medicinal chemistry and drug development. Additionally, (+)-Catharanthine's interaction with biological systems is an area of ongoing research, particularly in understanding its mechanism of action and potential therapeutic applications. Safety and handling precautions are essential due to its bioactive nature, and it is typically studied in controlled laboratory environments.
Formula:C21H24N2O2
InChI:InChI=1S/C21H24N2O2/c1-3-14-10-13-11-21(20(24)25-2)18-16(8-9-23(12-13)19(14)21)15-6-4-5-7-17(15)22-18/h4-7,10,13,19,22H,3,8-9,11-12H2,1-2H3/t13-,19+,21-/m0/s1
InChI key:InChIKey=CMKFQVZJOWHHDV-NQZBTDCJSA-N
SMILES:O=C(OC)C12C=3NC=4C=CC=CC4C3CCN5CC(C=C(CC)C51)C2
- Synonyms:
- (+)-3,4-Didehydrocoronaridine
- (+)-Cathranthine
- 6,9-Methano-5H-pyrido[1′,2′:1,2]azepino[4,5-b]indole, ibogamine-18-carboxylic acid deriv.
- Catharanthin
- Ibogamine-18-carboxylic acid, 3,4-didehydro-, methyl ester, (2α,5β,6α,18β)-
- Methyl (2Alpha,5Beta,18Beta)-3,4-Didehydroibogamine-18-Carboxylate
- Methyl (5Beta)-3,4-Didehydroibogamine-18-Carboxylate
- Methyl (5Beta,18Beta)-3,4-Didehydroibogamine-18-Carboxylate
- Catharanthine, (+)-
- (+)-Catharanthine
- See more synonyms
- Catharanthine
