CAS 24683-22-5
:2H-1,2-Benzothiazine-3-carboxamide, 4-hydroxy-, 1,1-dioxide
Description:
2H-1,2-Benzothiazine-3-carboxamide, 4-hydroxy-, 1,1-dioxide, commonly referred to by its CAS number 24683-22-5, is a chemical compound characterized by its unique bicyclic structure that incorporates both benzothiazine and carboxamide functionalities. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxamide and hydroxy groups. The 1,1-dioxide moiety suggests the presence of sulfone characteristics, which can influence its reactivity and stability. It may participate in various chemical reactions, including nucleophilic substitutions and redox reactions, owing to its functional groups. Additionally, compounds of this class are often studied for their biological activities, including potential pharmacological effects. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound's structural features suggest a diverse range of applications in medicinal chemistry and material science.
Formula:C9H8N2O4S
InChI:InChI=1S/C9H8N2O4S/c10-9(13)7-8(12)5-3-1-2-4-6(5)16(14,15)11-7/h1-4,11-12H,(H2,10,13)
InChI key:InChIKey=KIRHSGGIMMTVPT-UHFFFAOYSA-N
SMILES:OC=1C=2C(S(=O)(=O)NC1C(N)=O)=CC=CC2
Synonyms:- 2H-1,2-Benzothiazine-3-carboxamide, 4-hydroxy-, 1,1-dioxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
