
CAS 246852-07-3
:3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, hydrochloride (1:1)
Description:
3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, hydrochloride (1:1), with CAS number 246852-07-3, is a complex organic compound characterized by its pyridine ring structure, which is substituted at various positions. The presence of multiple functional groups, including carboxylic acid and ester moieties, contributes to its potential reactivity and solubility in polar solvents. The compound features a dihydropyridine structure, indicating it may exhibit properties typical of dihydropyridine derivatives, such as potential pharmacological activity. The inclusion of a chlorophenyl group suggests possible interactions with biological targets, while the aminoethoxy side chain may enhance solubility and bioavailability. As a hydrochloride salt, it is likely to be more stable and soluble in aqueous environments, making it suitable for various applications, including medicinal chemistry. Overall, this compound's unique structural features may confer specific biological activities, warranting further investigation for potential therapeutic uses.
Formula:C20H25ClN2O5·ClH
InChI:InChI=1S/C20H25ClN2O5.ClH/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21;/h5-8,17,23H,4,9-11,22H2,1-3H3;1H
InChI key:InChIKey=BSBOZVBRVBLCLO-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(C(C(OC)=O)=C(C)NC1COCCN)C2=C(Cl)C=CC=C2.Cl
Synonyms:- 3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, monohydrochloride
- Amlodipine hydrochloride
- 3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Amlodipine hydrochloride
CAS:Amlodipine hydrochloride is a salt of Amlodipine --- a medication used to lower blood pressure and prevent chest pain.Formula:C20H26Cl2N2O5Color and Shape:SolidMolecular weight:445.34
