
CAS 24687-70-5
:4-Methyl-7-(1-methylethyl)-1-azulenecarboxaldehyde
Description:
4-Methyl-7-(1-methylethyl)-1-azulenecarboxaldehyde, with the CAS number 24687-70-5, is an organic compound characterized by its unique azulene structure, which is a bicyclic compound known for its distinct blue color and aromatic properties. This compound features a carboxaldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl and isopropyl substituents on the azulene ring influences its physical and chemical properties, such as boiling point, solubility, and reactivity. Typically, compounds like this may exhibit interesting optical properties and can be utilized in the synthesis of various organic materials, including fragrances and dyes. Additionally, the structural features may impart specific biological activities, making it a candidate for further research in medicinal chemistry. Overall, 4-Methyl-7-(1-methylethyl)-1-azulenecarboxaldehyde represents a fascinating example of how structural variations in organic compounds can lead to diverse chemical behaviors and potential applications.
Formula:C15H16O
InChI:InChI=1S/C15H16O/c1-10(2)12-5-4-11(3)14-7-6-13(9-16)15(14)8-12/h4-10H,1-3H3
InChI key:InChIKey=VAMFCHMEVQNLHP-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(C(C)=CC=C(C(C)C)C2)=CC1
Synonyms:- 1-Formyl-4-methyl-7-isopropylazulene
- 1-Azulenecarboxaldehyde, 7-isopropyl-4-methyl-
- 1-Azulenecarboxaldehyde, 4-methyl-7-(1-methylethyl)-
- 4-Methyl-7-(1-methylethyl)-1-azulenecarboxaldehyde
- 7-Isopropyl-4-methyl-1-azulenecarbaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
