CAS 2469-34-3: Senegenin
Description:Senegenin, with the CAS number 2469-34-3, is a chemical compound classified as a triterpenoid saponin. It is primarily derived from the roots of the plant Polygala senega, which is traditionally used in herbal medicine. Senegenin exhibits a variety of biological activities, including expectorant, anti-inflammatory, and potential immunomodulatory effects. The compound is characterized by its complex structure, which includes a steroid-like backbone and various functional groups that contribute to its solubility and reactivity. Senegenin is known for its ability to enhance respiratory function and is often studied for its potential therapeutic applications in treating respiratory conditions. Additionally, it may possess antioxidant properties, making it of interest in the field of natural product research and pharmacology. Its safety profile and efficacy in clinical settings continue to be evaluated, highlighting the importance of further research into its mechanisms of action and potential health benefits.
Formula:C30H45ClO6
InChI:InChI=1S/C30H45ClO6/c1-26(2)10-11-30(25(36)37)9-6-17-22(18(30)13-26)16(15-31)12-21-27(17,3)8-7-20-28(21,4)14-19(32)23(33)29(20,5)24(34)35/h16,18-21,23,32-33H,6-15H2,1-5H3,(H,34,35)(H,36,37)/t16-,18+,19+,20-,21+,23+,27+,28+,29+,30-/m1/s1
InChI key:InChIKey=CWHJIJJSDGEHNS-MYLFLSLOSA-N
SMILES:O=C(O)C12CCC3=C(C(CCl)CC4C3(C)CCC5C(C(=O)O)(C)C(O)C(O)CC54C)C2CC(C)(C)CC1
- Synonyms:
- (2β,3β,4α,12α)-12-(Chloromethyl)-2,3-dihydroxy-27-norolean-13-ene-23,28-dioic acid
- 12-(Chloromethyl)-2β,3β-dihydroxy-27-norolean-13-ene-23,28-dioic acid
- 13-(chloromethyl)-2,3-dihydroxy-4,6a,11,11,14b-pentamethyl-2,3,4,4a,5,6,6a,7,8,9,10,11,12,12a,13,14,14a,14b-octadecahydropicene-4,8a(1H)-dicarboxylic acid
- 27-Norolean-13-ene-23,28-dioic acid, 12-(chloromethyl)-2,3-dihydroxy-, (2β,3β,4α,12α)-
- 27-Norolean-13-ene-23,28-dioic acid, 12-(chloromethyl)-2β,3β-dihydroxy-
- Tenuigenin
- Senegenin
