CymitQuimica logo

CAS 24693-44-5

:

3,4-Dihydro-8-methoxyisoquinoline

Description:
3,4-Dihydro-8-methoxyisoquinoline is a chemical compound belonging to the isoquinoline family, characterized by its bicyclic structure that includes a fused benzene and pyridine ring. This compound features a methoxy group (-OCH3) at the 8-position and a saturated bond at the 3,4-positions, which contributes to its unique chemical properties. It is typically a pale yellow to brown solid, and its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. The presence of the methoxy group can influence its solubility and reactivity, potentially enhancing its pharmacological properties. Additionally, compounds of this class may exhibit various biological activities, including antimicrobial and anticancer properties, although specific activities can vary widely based on structural modifications. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C10H11NO
InChI:InChI=1S/C10H11NO/c1-12-10-4-2-3-8-5-6-11-7-9(8)10/h2-4,7H,5-6H2,1H3
InChI key:InChIKey=WUBULMQIMWQJJF-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC=C1)CCN=C2
Synonyms:
  • 3,4-Dihydro-8-methoxyisoquinoline
  • Isoquinoline, 3,4-dihydro-8-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.