CAS 24696-24-0
:2,4-Furandicarboxylicacid, tetrahydro-4-methyl-3,5-dioxo- (8CI,9CI)
Description:
2,4-Furandicarboxylic acid, tetrahydro-4-methyl-3,5-dioxo- is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features two carboxylic acid functional groups (-COOH) at the 2 and 4 positions of the furan ring, contributing to its acidity and potential reactivity. The presence of the tetrahydro and methyl groups indicates that the compound has been saturated at certain positions, which can influence its physical properties, such as solubility and boiling point. The dioxo groups suggest that there are two carbonyl (C=O) functionalities, which can enhance its reactivity in various chemical reactions, including esterification and amidation. This compound may be of interest in the synthesis of biodegradable polymers and other materials due to its renewable nature, as it can be derived from biomass. Its CAS number, 24696-24-0, allows for easy identification in chemical databases and literature. Overall, this compound exhibits a unique combination of functional groups that can be leveraged in various chemical applications.
Formula:C7H6O7
InChI:InChI=1S/C7H6O7/c1-7(5(11)12)3(8)2(4(9)10)14-6(7)13/h2H,1H3,(H,9,10)(H,11,12)
InChI key:IPYIHLRBCAREHY-UHFFFAOYSA-N
SMILES:CC1(C(=O)C(OC1=O)C(=O)O)C(=O)O
Synonyms:- Protozymonicacid
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2,4-Furandicarboxylic acid, tetrahydro-4-methyl-3,5-dioxo- (8CI,9CI)
CAS:Formula:C7H6O7Molecular weight:202.1183
