CAS 247-92-7

[1,2,4]triazolo[3,4-b][1,3]benzothiazole

Description:

[1,2,4]Triazolo[3,4-b][1,3]benzothiazole is a heterocyclic compound characterized by its fused triazole and benzothiazole rings. This compound typically exhibits a range of interesting chemical properties due to the presence of both nitrogen and sulfur atoms in its structure. It is known for its potential biological activities, including antimicrobial and anticancer properties, making it a subject of interest in medicinal chemistry. The compound is generally stable under standard conditions but may undergo reactions typical of heterocycles, such as electrophilic substitution or nucleophilic attack, depending on the functional groups present. Its solubility can vary based on the solvent used, and it may exhibit fluorescence, which can be useful in various applications, including as a probe in biological studies. Additionally, [1,2,4]triazolo[3,4-b][1,3]benzothiazole can serve as a building block in the synthesis of more complex organic molecules, contributing to its relevance in organic synthesis and materials science.

Formula: C₈H₅N₃S

InChI: InChI=1/C8H5N3S/c1-2-4-7-6(3-1)11-5-9-10-8(11)12-7/h1-5H

SMILES: c1ccc2c(c1)n1cnnc1s2

Synonyms:

• 1,2,4-Triazolo[3,4-b]benzothiazole
• Benzo[4,5]thiazolo[2,3-c][1,2,4]triazole
• Benzo[D][1,2,4]Triazolo[3,4-B][1,3]Thiazole
• [1,2,4]Triazolo[3,4-b][1,3]benzothiazole

7-thia-2,4,5-triazatricyclo[6.4.0.0,2,6]dodeca-1(12),3,5,8,10-pentaene

CAS: 247-92-7

Formula: C₈H₅N₃S

Molecular weight: 175.2104

Ref: IN-DA002P2H

7-Thia-2,4,5-triazatricyclo[6.4.0.0,2,6]dodeca-1(12),3,5,8,10-pentaene

CAS: 247-92-7

7-Thia-2,4,5-triazatricyclo[6.4.0.0,2,6]dodeca-1(12),3,5,8,10-pentaene is a chlorinated aromatic hydrocarbon that inhibits the enzyme acetylcholinesterase in the central and peripheral nervous system by binding to the active site of this enzyme. It has been shown to be useful as an intermediate for producing other chemicals such as benzothiazoles or amides. 7-Thia-2,4,5-triazatricyclo[6.4.0.0,2,6]dodeca-1(12),3,5,8,10-pentaene is used in horticultural applications as a long acting herbicide because it binds tightly to soil particles and does not leach into groundwater or evaporate easily from foliage surfaces.

Formula: C₈H₅N₃S

Purity: Min. 95%

Molecular weight: 175.21 g/mol

Ref: 3D-AAA24792