CAS 24703-35-3

Bicyclogermacrene

Description:

Bicyclogermacrene is a bicyclic sesquiterpene, characterized by its complex structure that includes a bicyclic framework. It is primarily found in various plant species and is known for its role in the production of essential oils. The compound exhibits a distinctive aroma, often described as earthy or woody, which contributes to its use in perfumery and flavoring applications. Bicyclogermacrene is also recognized for its potential biological activities, including antimicrobial and insecticidal properties, making it of interest in agricultural and pharmaceutical research. Its molecular structure allows for various stereoisomers, which can influence its reactivity and interactions with biological systems. As a natural product, it is often studied for its ecological roles, particularly in plant defense mechanisms and interactions with pollinators. Overall, bicyclogermacrene is a significant compound in both natural product chemistry and applied sciences, with ongoing research exploring its diverse applications and benefits.

Formula: C₁₅H₂₄

InChI: InChI=1/C15H24/c1-11-5-6-14-12(2)7-8-15(3,4)10-13(14)9-11/h5,7,13-14H,6,8-10H2,1-4H3

InChI key: InChIKey=VPDZRSSKICPUEY-JEPMYXAXSA-N

SMILES: CC1(C)[C@]2([C@@]1(/C=C(\C)/CC/C=C(\C)/CC2)[H])[H]

Synonyms:

• Bicyclo[8.1.0]undeca-2,6-diene, 3,7,11,11-tetramethyl-, [1S-(1R*,2E,6E,10S*)]-
• Bicyclo[8.1.0]undeca-2,6-diene, 3,7,11,11-tetramethyl-, (1S,2E,6E,10R)-
• Bicyclo[8.1.0]undeca-2,6-diene, 3,7,11,11-tetramethyl-, (E,E)-(1S,10R)-(+)-
• (1S,2E,6E,10R)-3,7,11,11-Tetramethylbicyclo[8.1.0]undeca-2,6-diene
• Bicyclogermacrene