CAS 247058-03-3

[2,2':6',2''-Terpyridine]-3',4'-dicarboxylic acid

Description:

[2,2':6',2''-Terpyridine]-3',4'-dicarboxylic acid is a complex organic compound characterized by its unique structure, which includes a terpyridine core and two carboxylic acid functional groups. This compound features a tridentate ligand system, allowing it to coordinate with metal ions effectively, making it of interest in coordination chemistry and materials science. The presence of carboxylic acid groups enhances its solubility in polar solvents and contributes to its ability to form hydrogen bonds, which can influence its reactivity and interaction with other molecules. Additionally, the compound's aromatic nature provides stability and potential for π-π stacking interactions, which can be advantageous in various applications, including catalysis, sensor development, and as a building block in supramolecular chemistry. Its unique properties make it a subject of research in fields such as organic synthesis, coordination chemistry, and materials science, where it may be utilized in the development of novel materials or as a ligand in metal-organic frameworks.

Formula: C₁₇H₁₁N₃O₄

InChI: InChI=1/C17H11N3O4/c21-16(22)10-9-13(11-5-1-3-7-18-11)20-15(14(10)17(23)24)12-6-2-4-8-19-12/h1-9H,(H,21,22)(H,23,24)

SMILES: c1ccnc(c1)c1cc(c(c(c2ccccn2)n1)C(=O)O)C(=O)O

[2,2':6',2''-Terpyridine]-3',4'-dicarboxylic acid

CAS: 247058-03-3

Formula: C₁₇H₁₁N₃O₄

Molecular weight: 321.2869

Ref: IN-DA002P3X