CAS 24706-50-1
:3-(Phenylamino)-2-cyclohexen-1-one
Description:
3-(Phenylamino)-2-cyclohexen-1-one, also known by its CAS number 24706-50-1, is an organic compound characterized by its unique structure that includes a cyclohexene ring and an amino group attached to a phenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its reactivity and potential applications in organic synthesis. It is likely to be a yellow to brown solid at room temperature, with moderate solubility in organic solvents such as ethanol and dichloromethane. The presence of the phenylamino group suggests that it may participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic addition. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its stability and reactivity can be influenced by factors such as pH and the presence of other functional groups. Overall, 3-(Phenylamino)-2-cyclohexen-1-one is a versatile compound with potential applications in both research and industry.
Formula:C12H13NO
InChI:InChI=1S/C12H13NO/c14-12-8-4-7-11(9-12)13-10-5-2-1-3-6-10/h1-3,5-6,9,13H,4,7-8H2
InChI key:InChIKey=IVONJXTZXFTWNA-UHFFFAOYSA-N
SMILES:N(C1=CC(=O)CCC1)C2=CC=CC=C2
Synonyms:- 2-Cyclohexen-1-one, 3-(phenylamino)-
- 2-Cyclohexen-1-one, 3-anilino-
- 3-(Phenylamino)-2-cyclohexen-1-one
- 3-(Phenylamino)Cyclohex-2-En-1-One
- 3-Phenylamino-2-cyclohexenone
- Brn 2103381
- NSC 166087
- 3-Anilino-2-cyclohexen-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(Phenylamino)cyclohex-2-ene-1-one
CAS:3-(Phenylamino)cyclohex-2-ene-1-onePurity:≥95%Molecular weight:187.24g/mol3-Anilinocyclohex-2-en-1-one
CAS:Formula:C12H13NOPurity:98%Color and Shape:SolidMolecular weight:187.2423-Anilinocyclohex-2-en-1-one
CAS:3-Anilinocyclohex-2-en-1-one is an organic compound that has been modified with groups of atoms to give it a particular function. The functional theory states that the molecule will have a different shape, depending on the modifications made to it. 3-Anilinocyclohex-2-en-1-one is a fluorescing molecule with a low energy transfer rate. It is macroscopic and photophysical in nature, which means that it can be analysed by techniques such as polarimetry and FTIR spectroscopy. The modification of 3-Anilinocyclohex-2-en-1-one alters its frequency and may also stabilize the molecule.
Formula:C12H13NOPurity:Min. 95%Color and Shape:PowderMolecular weight:187.24 g/molRef: 3D-FA169191
Discontinued product



