CAS 247069-27-8

2,6-Diamino-3,5-difluoropyridine

Description:

2,6-Diamino-3,5-difluoropyridine is an organic compound characterized by its pyridine ring, which is substituted with two amino groups and two fluorine atoms. The presence of the amino groups at the 2 and 6 positions contributes to its potential as a building block in pharmaceuticals and agrochemicals, enhancing its reactivity and ability to form hydrogen bonds. The fluorine atoms at the 3 and 5 positions increase the compound's lipophilicity and may influence its biological activity. This compound is typically a solid at room temperature and is soluble in polar solvents, which is common for many pyridine derivatives. Its unique structure allows for various applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. Additionally, the presence of fluorine can enhance metabolic stability and bioavailability. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₅H₅F₂N₃

InChI: InChI=1/C5H5F2N3/c6-2-1-3(7)5(9)10-4(2)8/h1H,(H4,8,9,10)

SMILES: c1c(c(=N)[nH]c(c1F)N)F

Synonyms:

• 3,5-Difluoropyridine-2,6-Diamine
• N-[(9H-fluoren-9-ylmethoxy)carbonyl]-4-(trifluoromethyl)phenylalanine

2,6-Pyridinediamine, 3,5-difluoro-

CAS: 247069-27-8

Formula: C₅H₅F₂N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 145.1101

Ref: IN-DA002P3P

2,6-Diamino-3,5-difluoropyridine

CAS: 247069-27-8

2,6-Diamino-3,5-difluoropyridine

Purity: 98%

Color and Shape: Brown Powder

Molecular weight: 145.11g/mol

Ref: 54-PC2831

2,6-Diamino-3,5-difluoropyridine

CAS: 247069-27-8

Formula: C₅H₅F₂N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 145.113

Ref: 10-F049432