CymitQuimica logo

CAS 247098-18-6

:

4-ethyl-3-methyl-5-oxo-N-phenethyl-2H-pyrrole-1-carboxamide

Description:
4-Ethyl-3-methyl-5-oxo-N-phenethyl-2H-pyrrole-1-carboxamide is a chemical compound characterized by its unique pyrrole structure, which includes a carboxamide functional group and various alkyl substituents. The presence of the ethyl and methyl groups contributes to its hydrophobic characteristics, while the phenethyl group enhances its potential for interactions with biological systems. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential reactivity and stability under certain conditions, although specific stability and reactivity data would depend on environmental factors such as pH and temperature. The compound's CAS number, 247098-18-6, allows for easy identification in chemical databases, facilitating research and application in various fields, including drug development and organic synthesis. Overall, 4-ethyl-3-methyl-5-oxo-N-phenethyl-2H-pyrrole-1-carboxamide represents a complex organic molecule with potential utility in scientific research.
Formula:C16H20N2O2
InChI:InChI=1S/C16H20N2O2/c1-3-14-12(2)11-18(15(14)19)16(20)17-10-9-13-7-5-4-6-8-13/h4-8H,3,9-11H2,1-2H3,(H,17,20)
InChI key:InChIKey=VAQWDIFLYGGQLK-UHFFFAOYSA-N
SMILES:C(NCCC1=CC=CC=C1)(=O)N2C(=O)C(CC)=C(C)C2
Synonyms:
  • 1H-Pyrrole-1-carboxamide,3-ethyl-2,5-dihydro-4-methyl-2-oxo-N-(2-phenylethyl)
  • 3-Ethyl-2,5-dihydro-4-methyl-2-oxo-N-(2-phenylethyl)-1H-pyrrole-1-carboxamide
  • 3-Ethyl-4-methyl-2-oxo-N-phenethyl-2,5-dihydro-1H-pyrrole-1-carboxamide
  • 4-ethyl-3-methyl-5-oxo-N-(2-phenylethyl)-2H-pyrrole-1-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.