CAS 2471-92-3
:1,3-dihydro-2-benzothiophene
Description:
1,3-Dihydro-2-benzothiophene is an organic compound characterized by its bicyclic structure, which consists of a benzene ring fused to a thiophene ring. This compound features a saturated (dihydro) configuration, indicating the presence of two hydrogen atoms that saturate the double bonds typically found in thiophene. The molecular formula reflects the presence of carbon, hydrogen, and sulfur atoms, contributing to its unique chemical properties. It is generally a colorless to pale yellow liquid with a distinctive aromatic odor. The compound is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Its reactivity is influenced by the electron-rich nature of the thiophene ring, making it susceptible to electrophilic substitution reactions. Additionally, 1,3-dihydro-2-benzothiophene may exhibit interesting photophysical properties, which can be explored for use in materials science and organic electronics. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H8S
InChI:InChI=1/C8H8S/c1-2-4-8-6-9-5-7(8)3-1/h1-4H,5-6H2
SMILES:c1ccc2CSCc2c1
Synonyms:- Benzo(c)thiophene, 1,3-dihydro-
- 1,3-Dihydro-2-benzothiophene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzo[c]thiophene, 1,3-dihydro-
CAS:Formula:C8H8SPurity:95%Color and Shape:LiquidMolecular weight:136.21411,3-Dihydro-2-benzothiophene
CAS:Controlled ProductFormula:C8H8SColor and Shape:NeatMolecular weight:136.2141,3-Dihydro-2-benzothiophene
CAS:1,3-Dihydro-2-benzothiophene is a hydroxylated thiophene that binds to the benzothiazole receptor. It has been shown to inhibit the growth of cancer cells in vitro. 1,3-Dihydro-2-benzothiophene also has anti-inflammatory properties and is used to treat chronic bronchitis and inflammatory diseases such as Crohn's disease and ulcerative colitis. This drug may have some side effects, such as allergic reactions and low bioavailability. It can be toxic if taken by an infant or pregnant woman.Formula:C8H8SPurity:Min. 95%Molecular weight:136.22 g/mol




