CymitQuimica logo

CAS 247109-35-9

:

N-(3-Aminophenyl)-2-furancarboxamide

Description:
N-(3-Aminophenyl)-2-furancarboxamide, with the CAS number 247109-35-9, is an organic compound characterized by its unique structure that combines a furan ring with an amine and an amide functional group. This compound typically exhibits a molecular structure that includes a furan moiety, which contributes to its aromatic properties, and an amino group that can participate in hydrogen bonding and other interactions. The presence of the carboxamide group enhances its solubility in polar solvents and may influence its reactivity and biological activity. Such compounds often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the compound's stability, melting point, and solubility can vary based on environmental conditions and the presence of other functional groups. Overall, N-(3-Aminophenyl)-2-furancarboxamide represents a class of compounds that may have potential applications in drug development and materials science due to their diverse chemical properties.
Formula:C11H10N2O2
InChI:InChI=1S/C11H10N2O2/c12-8-3-1-4-9(7-8)13-11(14)10-5-2-6-15-10/h1-7H,12H2,(H,13,14)
InChI key:InChIKey=DNCIKRMVVUFNGX-UHFFFAOYSA-N
SMILES:C(NC1=CC(N)=CC=C1)(=O)C2=CC=CO2
Synonyms:
  • N-(3-Aminophenyl)-2-furancarboxamide
  • 2-Furancarboxamide, N-(3-aminophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.