CAS 24715-24-0

Ac-Gly-OSu

Description:

Ac-Gly-OSu, also known as N-acetylglycine N-hydroxysuccinimide ester, is a chemical compound commonly used in bioconjugation and peptide synthesis. It features an acetyl group attached to the amino acid glycine, along with a N-hydroxysuccinimide (OSu) moiety, which is known for its ability to react with amines to form stable amide bonds. This compound is typically a white to off-white solid and is soluble in polar organic solvents. Its reactivity is primarily attributed to the N-hydroxysuccinimide group, which facilitates the coupling of biomolecules, making it valuable in the development of bioconjugates, such as labeled proteins or peptides. Ac-Gly-OSu is often utilized in various biochemical applications, including drug delivery systems and the modification of surfaces for biosensors. Safety precautions should be taken when handling this compound, as with many reactive chemicals, to avoid potential hazards associated with its use.

Formula: C₈H₁₀N₂O₅

InChI: InChI=1/C8H10N2O5/c1-5(11)9-4-8(14)15-10-6(12)2-3-7(10)13/h2-4H2,1H3,(H,9,11)

SMILES: CC(=NCC(=O)ON1C(=O)CCC1=O)O

Acetamide, N-[2-[(2,5-dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl]- (9CI)

CAS: 24715-24-0

Formula: C₈H₁₀N₂O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 214.1754

Ref: IN-DA002P6C

Acetyl-glycine N-hydroxysuccinimide ester

CAS: 24715-24-0

Acetyl-glycine N-hydroxysuccinimide ester is a reagent that can be used as a building block for the synthesis of peptides and proteins. It is also an intermediate in the synthesis of other chemical compounds, such as pharmaceuticals. This compound has been extensively used in research laboratories for its high quality and versatility.

Formula: C₈H₁₀N₂O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 214.18 g/mol

Ref: 3D-FA47429