CAS 24716-93-6
:(1S,2S)-2-ammoniocyclohexanecarboxylate
Description:
(1S,2S)-2-ammoniocyclohexanecarboxylate, with the CAS number 24716-93-6, is a chiral compound characterized by its cyclohexane ring structure, which features an amino group and a carboxylate functional group. This compound exists as a zwitterion, meaning it has both a positive and a negative charge, contributing to its solubility in polar solvents. The presence of the amino group allows for potential interactions such as hydrogen bonding, which can influence its reactivity and stability. The stereochemistry indicated by the (1S,2S) designation suggests specific spatial arrangements of the substituents around the cyclohexane ring, which can significantly affect the compound's biological activity and interactions with other molecules. This compound may be of interest in various fields, including medicinal chemistry and organic synthesis, due to its potential applications in drug development and as a chiral building block in synthetic pathways. Its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and environment in which it is studied.
Formula:C7H13NO2
InChI:InChI=1/C7H13NO2/c8-6-4-2-1-3-5(6)7(9)10/h5-6H,1-4,8H2,(H,9,10)/t5-,6-/m0/s1
SMILES:C1CC[C@@H]([C@H](C1)C(=O)O)N
Synonyms:- (1S,2S)-2-Aminocyclohexanecarboxylic Acid
- cyclohexanecarboxylic acid, 2-amino-, (1S,2S)-
- Cyclohexanecarboxylic acid, 2-amino-, trans-
- trans-2-Aminocyclohexanecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(1S,2S)-2-Aminocyclohexanecarboxylic acid, 97%
CAS:<p>(1S,2S)-2-Aminocyclohexanecarboxylic acid is used in the preparation of enantiomerically pure beta-amino acids. It is also involved in the synthesis of mono and dihydroxylated derivatives of 2-aminocyclohexanecarboxylic acid by Diels-Alder adduct of ethyl(E)-3-nitroacrylate and furan. This Thermo Sc</p>Formula:C7H13NO2Purity:97%Molecular weight:143.19Cyclohexanecarboxylic acid, 2-amino-, (1S,2S)-
CAS:Formula:C7H13NO2Purity:98%Color and Shape:LiquidMolecular weight:143.1836(1S,2S)-2-Aminocyclohexanecarboxylic acid
CAS:(1S,2S)-2-Aminocyclohexanecarboxylic acidPurity:≥95%Molecular weight:143.18g/mol(1S,2S)-2-Aminocyclohexanecarboxylic acid
CAS:Formula:C7H13NO2Purity:95.0%Color and Shape:SolidMolecular weight:143.186



