
CAS 247195-81-9
:1-Azabicyclo[2.2.2]octan-3-ol, 3-(chloromethyl)-, hydrochloride (1:1)
Description:
1-Azabicyclo[2.2.2]octan-3-ol, 3-(chloromethyl)-, hydrochloride (1:1), commonly referred to as a bicyclic amine derivative, is characterized by its unique bicyclic structure that incorporates a nitrogen atom within a saturated ring system. This compound features a hydroxyl group (-OH) and a chloromethyl group (-CH2Cl) attached to the bicyclic framework, contributing to its reactivity and potential applications in medicinal chemistry. The hydrochloride salt form indicates that the compound is protonated, enhancing its solubility in aqueous environments, which is beneficial for biological activity. Typically, such compounds exhibit properties that may include moderate to high polarity, making them suitable for interactions with biological targets. The presence of the chloromethyl group can facilitate further chemical modifications, potentially leading to the development of novel pharmaceuticals. Overall, this compound's structural characteristics and functional groups suggest it may play a role in various chemical reactions and biological processes, warranting further investigation into its pharmacological properties and applications.
Formula:C8H14ClNO·ClH
InChI:InChI=1S/C8H14ClNO.ClH/c9-5-8(11)6-10-3-1-7(8)2-4-10;/h7,11H,1-6H2;1H
InChI key:InChIKey=HQBMHODSJGNNIK-UHFFFAOYSA-N
SMILES:C(Cl)C1(O)C2CCN(C1)CC2.Cl
Synonyms:- 1-Azabicyclo[2.2.2]octan-3-ol, 3-(chloromethyl)-, hydrochloride
- 3-(Chloromethyl)-3-quinuclidinol hydrochloride
- 1-Azabicyclo[2.2.2]octan-3-ol, 3-(chloromethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.