CAS 2472-16-4

chloro-(7-methoxy-1-oxo-tetralin-2-yl)azanide

Description:

Chloro-(7-methoxy-1-oxo-tetralin-2-yl)azanide, with the CAS number 2472-16-4, is a chemical compound that features a tetralin structure, which is a bicyclic compound consisting of a fused benzene and cyclohexane ring. The presence of a methoxy group (-OCH3) at the 7-position contributes to its unique reactivity and solubility characteristics, while the chloro substituent introduces halogen properties that can influence its biological activity and interaction with other molecules. The oxo group (carbonyl) at the 1-position indicates the presence of a ketone functionality, which can participate in various chemical reactions, such as nucleophilic additions. The azanide functional group suggests the presence of nitrogen, which may impart basicity and potential for forming hydrogen bonds. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific characteristics, including solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups.

Formula: C₁₁H₁₁ClNO₂

InChI: InChI=1/C11H11ClNO2/c1-15-8-4-2-7-3-5-10(13-12)11(14)9(7)6-8/h2,4,6,10H,3,5H2,1H3/q-1

SMILES: COc1ccc2CCC(C(=O)c2c1)[N-]Cl

2-Amino-3,4-dihydro-7-methoxy-2H-1-naphthalenone, hydrochloride

Controlled Product

CAS: 2472-16-4

Please enquire for more information about 2-Amino-3,4-dihydro-7-methoxy-2H-1-naphthalenone, hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₁H₁₄ClNO₂

Purity: Min. 95%

Molecular weight: 227.69 g/mol

Ref: 3D-FA17490