CAS 24730-31-2
:surfactin from bacillus subtilis
Description:
Surfactin is a lipopeptide biosurfactant produced by the bacterium Bacillus subtilis, known for its unique amphiphilic structure, which consists of a cyclic peptide linked to a long fatty acid chain. This structure allows surfactin to significantly reduce surface tension and interfacial tension, making it an effective emulsifying agent. Surfactin exhibits a range of biological activities, including antimicrobial, antiviral, and antifungal properties, which contribute to its potential applications in pharmaceuticals, agriculture, and environmental remediation. The compound is characterized by its ability to form micelles and stabilize emulsions, enhancing the solubility of hydrophobic compounds. Additionally, surfactin is biodegradable and environmentally friendly, making it a sustainable alternative to synthetic surfactants. Its production can be influenced by various factors, including nutrient availability and fermentation conditions, which can affect yield and activity. Overall, surfactin's multifunctional properties and eco-friendly nature position it as a valuable compound in various industrial and biotechnological applications.
Formula:C53H93N7O13
InChI:InChI=1/C53H93N7O13/c1-30(2)20-18-16-14-13-15-17-19-21-36-28-43(61)54-37(22-23-44(62)63)47(66)55-38(24-31(3)4)48(67)57-40(26-33(7)8)51(70)60-46(35(11)12)52(71)58-41(29-45(64)65)50(69)56-39(25-32(5)6)49(68)59-42(27-34(9)10)53(72)73-36/h30-42,46H,13-29H2,1-12H3,(H,54,61)(H,55,66)(H,56,69)(H,57,67)(H,58,71)(H,59,68)(H,60,70)(H,62,63)(H,64,65)/t36-,37+,38+,39-,40-,41+,42+,46+/m1/s1
Synonyms:- Surfactin
- 3-[(9S,12S,15R,18S,21R)-9-(carboxymethyl)-3,6,15,18-tetrakis(2-methylpropyl)-25-(10-methylundecyl)-2,5,8,11,14,17,20,23-octaoxo-12-(propan-2-yl)-1-oxa-4,7,10,13,16,19,22-heptaazacyclopentacosan-21-yl]propanoic acid
- 3-[(3S,6R,9S,12S,15R,18S,21S,25R)-9-(carboxymethyl)-3,6,15,18-tetrakis(2-methylpropyl)-25-(10-methylundecyl)-2,5,8,11,14,17,20,23-octaoxo-12-(propan-2-yl)-1-oxa-4,7,10,13,16,19,22-heptaazacyclopentacosan-21-yl]propanoic acid
- surfactin C
- surfactin from bacillus subtilis
- Surfactin peptide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Surfactin
CAS:Surfactin is a potent cyclic lipopeptide biosurfactants that mediates flux of mono-and divalent cations, such as calcium, across lipid bilayer membranes, withFormula:C53H93N7O13Purity:mixture - mixtureColor and Shape:SolidMolecular weight:1036.34Surfactin
CAS:Formula:C53H93N7O13Purity:≥ 98.0%Color and Shape:White to faint-yellow powderMolecular weight:1036.34Surfactin
CAS:<p>Applications Surfactin is a lipopeptide antibiotic and biosurfactant.<br></p>Formula:C53H93N7O13Color and Shape:NeatMolecular weight:1036.34Surfactin
CAS:<p>Surfactin is a cyclic lipopeptide that belongs to the group of antimicrobial agents. It has been shown to have anti-bacterial, antifungal, and antiviral properties. Surfactin can also be used as a surfactant in wastewater treatment and biosurfactant production. Surfactin also has an inhibitory effect on the growth of wild-type strains of bacteria. The biological properties of suractin are associated with its ability to disrupt the outer membrane of mitochondria, which may lead to cell death. This drug also inhibits polymerase chain reaction (PCR) activity and enzyme activities by binding to DNA or proteins that are required for their synthesis.</p>Formula:C53H93N7O13Purity:Min. 95%Color and Shape:White To Light (Or Pale) Yellow SolidMolecular weight:1,036.34 g/mol





