CAS 24738-51-0

(2E,4E)-N-(2-methylpropyl)dodeca-2,4-dienamide

Description:

(2E,4E)-N-(2-methylpropyl)dodeca-2,4-dienamide is an organic compound characterized by its long carbon chain and specific double bond configurations. It features a dodeca backbone, indicating a 12-carbon chain, with two conjugated double bonds located at the 2nd and 4th positions, which contribute to its reactivity and potential for isomerization. The presence of the N-(2-methylpropyl) substituent introduces a branched alkyl group, enhancing its hydrophobic characteristics and potentially influencing its biological activity. This compound is likely to exhibit properties typical of amides, such as moderate polarity due to the carbonyl group, while the diene structure may allow for various chemical reactions, including polymerization or addition reactions. Its unique structure may also confer specific interactions in biological systems, making it of interest in fields such as medicinal chemistry or materials science. Overall, the compound's characteristics are defined by its structural features, which influence its physical and chemical behavior in various environments.

Formula: C₁₆H₂₉NO

InChI: InChI=1/C16H29NO/c1-4-5-6-7-8-9-10-11-12-13-16(18)17-14-15(2)3/h10-13,15H,4-9,14H2,1-3H3,(H,17,18)/b11-10+,13-12+

Synonyms:

• 2,4-dodecadienamide, N-(2-methylpropyl)-, (2E,4E)-

Sodium metatungstate

CAS: 24738-51-0

Sodium metatungstate

Purity: ≥80%

Molecular weight: 2985.99g/mol

Ref: 54-BUP20835

2,4-Dodecadienoic acid isobutylamide

CAS: 24738-51-0

2,4-Dodecadienoic acid isobutylamide is a useful organic compound for research related to life sciences.

Formula: C₁₆H₂₉NO

Color and Shape: Solid

Molecular weight: 251.414

Ref: TM-T125210

Dodeca 2e,4e-dienoic acid isobutylamide

CAS: 24738-51-0

Acyclic amide

Formula: C₁₆H₂₉NO

Purity: ≥ 90.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 251.41

Ref: 5G-24688

Kalecide

Controlled Product

CAS: 24738-51-0

Formula: C₁₆H₂₉NO

Color and Shape: Neat

Molecular weight: 251.41

Ref: TR-K445015

Dodeca-2(E),4(E)-dienoic acid isobutlamide

CAS: 24738-51-0

A new class of cannabinomimetic.  This class of compounds modulates TNFα mRNA expression in human monocytes/macrophages via the CB2 receptor.Soluble in DMSO and ethanol (over 25 mg/ml).

Formula: C₁₆H₂₉NO

Purity: Min. 95%

Molecular weight: 251.41 g/mol

Ref: 3D-FD171294