CAS 24748-23-0: 3,6,9-Triethyl-3,6,9-trimethyl-1,2,4,5,7,8-hexoxonane

Description:3,6,9-Triethyl-3,6,9-trimethyl-1,2,4,5,7,8-hexoxonane, with the CAS number 24748-23-0, is a complex organic compound characterized by its unique molecular structure, which includes multiple ethyl and methyl substituents on a hexoxonane backbone. This compound is likely to exhibit properties typical of polyfunctional organic molecules, such as varying solubility in organic solvents and potential reactivity due to the presence of multiple functional groups. The presence of ethyl and methyl groups suggests that it may have a relatively low boiling point and moderate volatility. Additionally, the hexoxonane structure may impart specific stereochemical properties, influencing its interactions in chemical reactions. Its applications could range from use in organic synthesis to potential roles in materials science, depending on its stability and reactivity. However, detailed studies would be necessary to fully understand its physical and chemical properties, including its stability, reactivity, and potential applications in various fields.

Formula:C₁₂H₂₄O₆

InChI:InChI=1S/C12H24O6/c1-7-10(4)13-15-11(5,8-2)17-18-12(6,9-3)16-14-10/h7-9H2,1-6H3

InChI key:InChIKey=KVWLLOIEGKLBPA-UHFFFAOYSA-N

SMILES:O1OC(OOC(OOC1(C)CC)(C)CC)(C)CC