CAS 2475-82-3

2-amino-5-ethylbenzoic acid

Description:

2-Amino-5-ethylbenzoic acid, with the CAS number 2475-82-3, is an aromatic amino acid derivative characterized by the presence of an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a benzene ring. The ethyl group is located at the 5-position relative to the carboxylic acid, contributing to its hydrophobic characteristics. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. It exhibits properties typical of amino acids, including the ability to participate in acid-base reactions due to its carboxylic acid and amino functionalities. Additionally, it can act as a building block in organic synthesis and may have applications in pharmaceuticals or as a biochemical reagent. The presence of both the amino and carboxylic acid groups allows it to engage in various biochemical interactions, making it of interest in studies related to amino acid metabolism and protein synthesis.

Formula: C₉H₁₁NO₂

InChI: InChI=1/C9H11NO2/c1-2-6-3-4-8(10)7(5-6)9(11)12/h3-5H,2,10H2,1H3,(H,11,12)

SMILES: CCc1ccc(c(c1)C(=O)O)N

Synonyms:

• Benzoic Acid, 2-Amino-5-Ethyl-

Benzoic acid, 2-amino-5-ethyl-

CAS: 2475-82-3

Formula: C₉H₁₁NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 165.1891

Ref: IN-DA002PBI

2-Amino-5-ethylbenzoic acid

CAS: 2475-82-3

2-Amino-5-ethylbenzoic acid

Purity: 97%

Molecular weight: 165.19g/mol

Ref: 54-OR1057580

2-Amino-5-ethylbenzoic acid

CAS: 2475-82-3

2-Amino-5-ethylbenzoic acid (2A5EB) is a chalcone that has been shown to have antimicrobial and antitumor properties. 2A5EB inhibits the synthesis of proteins by binding to the ribosomal RNA, which prevents the production of proteins vital for cell division. 2A5EB also inhibits protein synthesis by binding to the ribosomal RNA in mammalian cells. 2A5EB has been shown to have anticancer activity against human cancer cell lines and has also been used as a lead compound in drug discovery programs.

Formula: C₉H₁₁NO₂

Purity: Min. 95%

Molecular weight: 165.19 g/mol

Ref: 3D-CAA47582