CAS 247564-66-5: 4,6-Difluoroindole-2-carboxylic acid
Description:4,6-Difluoroindole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of two fluorine atoms at the 4 and 6 positions of the indole ring significantly influences its chemical properties, including its reactivity and polarity. The carboxylic acid functional group at the 2 position contributes to its acidity and solubility in polar solvents. This compound is of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing various derivatives. Its fluorinated nature may enhance lipophilicity and metabolic stability, making it a candidate for drug development. Additionally, the compound's unique structure allows for various synthetic modifications, which can lead to the exploration of new pharmacological applications. Overall, 4,6-Difluoroindole-2-carboxylic acid is a versatile compound with significant implications in research and development within the chemical and pharmaceutical industries.
Formula:C9H5F2NO2
InChI:InChI=1S/C9H5F2NO2/c10-4-1-6(11)5-3-8(9(13)14)12-7(5)2-4/h1-3,12H,(H,13,14)
InChI key:InChIKey=OCHGGXDZJGAUEU-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=2C(F)=CC(F)=CC2N1
- Synonyms:
- 1H-indole-2-carboxylic acid, 4,6-difluoro-
- T56 Bmj Cvq Ff Hf
- 4,6-difluoro-1H-indole-2-carboxylic acid

1H-Indole-2-carboxylic acid, 4,6-difluoro-
Ref: IN-DA002PC8
1g | 39.00 € | ||
5g | 104.00 € | ||
10g | 160.00 € | ||
25g | 285.00 € | ||
250mg | 25.00 € |

Ref: 54-PC3022
1g | 47.00 € | ||
5g | 155.00 € | ||
25g | 672.00 € | ||
100g | 2,434.00 € | ||
250mg | 32.00 € |

4,6-Difluoroindole-2-carboxylic acid
Ref: 10-F050360
1g | 27.00 € | ||
5g | 114.00 € | ||
10g | 213.00 € | ||
25g | 450.00 € |

4,6-Difluoroindole-2-carboxylic acid
Ref: 3D-FD33923
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
500mg | Discontinued | Request information |